How much energy would be needed to raise the temperature of a 5kg block of concrete by 10°C?

Answers

Answer 1

Answer:

5 x 10 x 3200 = 170 000J or 170kJ

Explanation:

i searched it lol

Answer 2

The energy needed to raise the temperature of a 5 kg block of concrete by 10° C is 170 000J or 170kJ.

What is energy?

Energy is defined as a quantitative property that is transferred to a body or to a physical system. It can also be defined as capacity of doing work.

There are basically five forms of energy

Electrical energyChemical energyMechanical energyThermal energyNuclear energy

Heat energy = mass x heat capacity x raise in temperature

                     = 5 x 3200 x 10

                     = 170000 J or 170 kJ

Thus, the energy needed to raise the temperature of a 5 kg block of concrete by 10° C is 170 000J or 170kJ.

To learn more about energy, refer to the link below:

https://brainly.com/question/1932868

#SPJ2


Related Questions

What is 13.48cm+7.6cm rounded to the correct number of significant figures?

Answers

The lowest amount of significant figures has to be what the answer is...

7.6cm is 2 sig figs where 13.48 is 4, so the answer can only really be as precise as the smallest one (7.6)

7.6 + 13.48 = 21.08cm

Put it into 2 sig figs makes it
=21 cm (2s.f) <— don’t forget to write 2 sig figs next to it because otherwise it is a false answer

John is performing an experiment in which a solution alternates between a clear color and a bluish-purple color at a regular time interval. He observes that the time interval between color changes is 30 seconds (s). Sally replicates the experiment with the same solution, but at a temperature that is 10 degrees Celsius (°C) higher. What is the most likely time interval between color changes at this higher temperature? *

Answers

Answer:

15 sec

Explanation:

is xenon a metal and is Beryllium a metal

Answers

Answer:

No and yes

Explanation:

Xenon is a noble gas and beryllium is a metal

Answer: no and yes i also agree

Xenon is a noble gas and Beryllium a metal

Explanation:

Calculate the speed for a car that went a distance of 150 kilometers in 2 hours time. btw this is science

Answers

Answer:

The speed of the car is 75 km per hour

Explanation:

Speed is distance over time so 150 km divided by 2 hours is 75km per hour.

Please mark brainliest!!! Thanks.

Is copper sulphate malleable?

Answers

Answer:

Yes, Copper (Cu) in its pure form is a reddish-brown metallic element with high ductility and malleability that is an excellent conductor of heat and electricity: atomic weight 63.54; atomic number 29; density 8.94 g/cm3; melting point 1083°C; and boiling point 2595°C.

Answer:

no ,its not malleable

Explanation:

copper II sulphate is a blue compound , which is brittle solid , crystalline .

copper metal is malleable and ductile

True or False;
aa is faster moving lava than pahoehoe?

Answers

Answer:

It is false :l

Explanation:

Pahoehoe is a smooth and continuous lava crust. Pahoehoe forms when the effusion rate is low and consequently the velocity of lava flow is slow. Pahoehoe lava flow is usually at least 10 times slower than typical aa lava flow.

:/

How many elements do all the “s” orbital span (go across) in each period?
a) 2
b) 6
c) 10
d) 14

Answers

It is A.

The s sublevel has just one orbital, so can contain 2 electrons max.

The elements do all the “s” orbital span (go across) in each period is 2. Thus option a is correct.

What are elements?

Elements are defined as  a pure substance made up of only one sort of atom with the same number of protons in its nucleus.

It can also be defined as the a substance that can't be broken down into anything else.

Sublevels are defined as a quantum theory-defined energy level Sublevels are energies associated with electrons in chemistry.

There are mainly four sublevels

s sublevelp subleveld sublevelf sublevel

Thus, the elements do all the “s” orbital span (go across) in each period is 2. Thus option a is correct.

To learn more about elements, refer to the link below:

https://brainly.com/question/13025901

#SPJ2

During free fall which object would have a greater acceleration, an object with a mass of 240 kg or an object with a mass of 10 kg? Explain your answer.

Answers

Answer:

Leroy Jeakins

Explanation:

Catus jack f me in the asss

How many elements are in H
a) 3
b) 2
c) 1
d) 5​

Answers

Answer: C (1)

Explanation:

H is only the element hydrogen.

Hydrogen is an element itself, so therefore there is only one element in it! The answer is C. Hope this helps!

Sodium metal reacts violently with water and chlorine is a toxic gas, yet we eat sodium chloride. Why is this possible? Select one: a. The properties of compounds are different from the properties of the elements that form the compounds.
b. The properties of compounds are identical to the properties of the elements that form the compounds, and we should not eat sodium chloride because it is toxic.
c. The physical properties of compounds are different from the physical properties of the elements that form the compounds, but the chemical properties of the elements and compound are the same.
d. The chemical properties of compounds are different from the chemical properties of the elements that form the compounds, but the physical properties of the elements and compound are the same.

Answers

Answer:

The properties of compounds are different from the properties of the elements that form the compounds.

Explanation:

When elements form compounds, their properties are significantly modified. The physical and chemical properties of compounds and that of the elements that compose them are significantly different.

The introduction of chemical bonds between different atoms in compounds make the compounds to differ from elements where the atoms are bonded to atoms of the same element.

For an object to remain at rest which of the following statements must be true

Answers

Answer:

An object that is at rest will stay at rest unless a force acts upon it. An object that is in motion will not change its velocity unless a force acts upon it. This is known as uniform motion. An object continues to do whatever it happens to be doing unless a force is exerted upon it.

Explanation: NEWTONS laws of motion

Does Rubidium (Rb) have high or low electronegativity?

Answers

Answer:

high

Explanation:

Helpppppp!!!!! It’s due today
URGENT!!!!!

Answers

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

Help please !
A
B
C
D

Answers

Answer:

the answer is letter B. the entropy

Answer:B (the entropy of the gas will increase, and it will spread out to fill both containers) is the correct answer

If a neutral compound is composed of carbon and hydrogen and you know that it has exactly 2 carbons connected by a double bond, how many hydrogens will the compound have?

Answers

Answer: 4 hydrogens

Explanation:

This is what the structure will look like C=C. Remember that it's important that all structures have a complete octet. As it looks right now each carbon is sharing 4 valence electrons so each needs 2 more bonds to hydrogen complete its octet.

Answer: 4 hydrogens

Explanation:

Ammonia is formed from the reaction of nitrogen and hydrogen according to the equation:
N2(g) + 3H2(g) 2NH3(g)
What is the maximum number of moles of ammonia that can be formed from the reaction of 27 moles of hydrogen?
A
41
B
27
18
D
9

Answers

Answer:

18 mol NH₃

General Formulas and Concepts:

Chemistry - Stoichiometry

Using Dimensional Analysis

Explanation:

Step 1: Define

RxN:   N₂ (g) + 3H₂ (g) → 2NH₃ (g)

Given:   27 moles H₂

Step 2: Stoichiometry

[tex]27 \ mol \ H_2(\frac{2 \ mol \ NH_3}{3 \ mol \ H_2} )[/tex] = 18 mol NH₃

Step 3: Check

We are given 2 sig figs.

Since our final answer is in 2 sig figs, we do not need to round.

Which compound is
ionic?

Answers

Answer:

chemistry

Explanation:


What is the molarity of a hydrochloric acid solution, when 30.0 mL is neutralized by 48.0 mL of 0.100 mol/L
calcium hydroxide?

Answers

The molarity of a hydrochloric acid solution : 0.32 M

Further explanation  

Titration is a procedure for determining the concentration of a solution by reacting with another solution which is known to be concentrated (usually a standard solution).

Titrations can be distinguished including acid-base titration, depositional titration, and redox titration. An acid-base titration is the principle of neutralization of acids and bases is used.  

Acid-base titration formula  

Ma. Va. na = Mb. Vb. nb  

Ma, Mb = acid base concentration  

Va, Vb = acid base volume  

na, nb = acid base valence  

1 ⇒HCl (valence=1, HCl ⇒H⁺+Cl⁻, one H⁺)

2⇒Ca(OH)₂(valence=2, Ca(OH)₂⇒Ca²⁺+2OH⁻, two OH⁻)

M₂=0.1 M

V₂=48 ml=0.048 L

V₁=30 ml=0.03 L

[tex]\tt M_1.V_1.n_1=M_2.V_2.n_2\\\\M_1\times 0.03\times 1=0.1\times 0.048\times 2\\\\M_1=0.32[/tex]

Here is a model of the sun earth system at a certain point in earths orbit around the sun based on the model which statement best explains my point is is experiencing summer

Answers

Answer:

the earth is tilted towards the sun

Explanation:

In the context, there is a sun and earth system and at a certain point when the earth is moving in its orbit around he sun, some point on the earth experiences the summers season. This is because at this point of the earths revolution, the point on the earth is facing the sun and is also tilted towards the sun. So at this point the sun rays fall directly at the surface. While the place which is tilted away from the sun, experiences winter season.

Answer:

Earth's northern hemisphere is tilted toward the Sun.

Darwin told us that science:
saves lives

Answers

Answer:yup!!

Explanation:

400 liters of a certain gas is collected at STP. What will the volume be at 273 C and 190 torr pressure?

Answers

Answer:

2.00 L of a gas is collected at 25.0°C and 745.0 mmHg. What is the volume at STP? STP is a common abbreviation for "standard temperature and pressure." You have to recognize that five values are given in the problem and the sixth is an x. Also ... 273 1. A gas has a volume of 800.0 mL at minus 23.00 °C and 300.0 torr.

Explanation:

A sealed can of soda contain a pressure of 1.15 atm at 23°C. What is the new pressure at 79 °C? Report your answer to the hundredths place (two decimal places) You do NOT need units in your answer

Answers

Answer:

P₂ = 1.37

Explanation:

Given data:

Initial pressure = 1.15 atm

Initial temperature = 23°C (23+273= 296 K)

Final pressure = ?

Final temperature = 79°C (79+273=352 K)

Solution:

According to Gay-Lussac Law,

The pressure of given amount of a gas is directly proportional to its temperature at constant volume and number of moles.

Mathematical relationship:

P₁/T₁ = P₂/T₂

Now we will put the values in formula:

1.15 atm / 296 K = P₂/352 K

P₂ = 1.15 atm × 352 K / 296 K

P₂ = 404.8 atm. K /296 K

P₂ = 1.37 atm

Hi can someone help me with this question!
First one to answer it I will make u brainliest

Answers

Answer:

Test 2

Explanation:

............................................

Answer:

(B) Test 2

Explanation:

The entire substance changed, and turned into a liquid.

formal units are formed by?

Answers

Answer:

However, when formal units are used to measure length, the measurement can usually be read from a scale on a ruler or tape, which shows units of a particular size. Unit iteration involves knowledge of repeatedly placing identical tightly packing units so that there are no overlaps or gaps.

Explanation:

3. How many moles are in 1.49 x 1023 molecules of iodine?

Answers

Answer:

The answer is 0.25 moles

Explanation:

To find the number of moles in a substance given it's number of entities we use the formula

[tex]n = \frac{N}{L} \\ [/tex]

where n is the number of moles

N is the number of entities

L is the Avogadro's constant which is

6.02 × 10²³ entities

From the question we have

[tex]n = \frac{1.49 \times {10}^{23} }{6.02 \times {10}^{23} } = \frac{1.49}{6.02} \\ = 0.247508305...[/tex]

We have the final answer as

0.25 moles

Hope this helps you

A student observes that a popcorn kernel has a hard coat. He places the kernel in a moist paper towel and observes it for several days. He notices that the coat splits and a small root emerges. He concludes that

Answers

Answer: Water inside the seed coat creating a pushing force, breaking the seed coat.

Explanation:

Seed germination can be defined as the process by which a new plant emerge out from a seed. The radicle is the first emerging part from a seed and it develops into a root and the plumule is the second emerging part and it develops into a shoot. The light, water, adequate temperature, and soil are the factors that are necessary for seed germination.

According to a given situation, the popcorn kernel will receive the moisture necessary for the germination process, the water will imbibe into the seed coat creating pressure inside the seed and which will cause the seed coat to break and the new plant parts or seedling will emerge out of the seed coat.

when a substance melts the kinetic energy

A Decreases then increase

B Decrease

C Stays the same

D Increase

Answers

Answer:

C stays The same.

Is the answer.

Answer = C

the overall kinetic energy level between the two substances actually remains the same

Hydrogen bond is not formed by 1) oxygen 2) nitrogen 3) chlorine
PLEASE HELP!!!
i mean which cant form hydrogen bond

Answers

Answer:

Chlorine

Explanation:

Even though chlorine is highly electronegative, the best answer is no, and in this class we will consider chlorine not to form hydrogen bonds (even though it has the same electronegativity as oxygen). This is because chlorine is large and its lone electron is in a diffuse orbital, covering a large area, and thus do not have the high charge density to act as a strong hydrogen bond acceptor. But it does form weak hydrogen bonds in solid crystalline hydrogen chloride at very low temperatures.

How does nano frabic work

Answers

Answer:

Nano silver is woven into fabric to give it anti-bacterial properties.

Explanation:

Helps by fending off the bacteria that make those clothes smell after you sweat. Nano-titanium dioxide adds sun protection to clothing just as it does in sunscreen. The use of nanoparticles to achieve fresh-smelling clothes and UV protection may not be safe.

The total amount of energy before and after a chemical reaction is the same. Therefore, energy is _____.
created

destroyed

converted

conserved

Answers

Answer:

Option (a) is the correct answer.

Explanation:

The law of conservation of energy states that energy can neither be created nor it can be destroyed. It can only be transformed from one form to another.

Therefore, the total amount of energy before and after a chemical reaction is the same. Thus, energy is conserved.

Therefore, we can conclude that option (a) is the correct answer.

Answer:

conserved

Explanation:

law of conservation of energy says that energy can neither be created or destroyed

Other Questions
PLEASEEEEE HELPPPPPP ASAPPPPPPPP What is the slope of (10, 10) and (2, 1). Brita has a monthly budget of x dollars. She spends $1,425 on her mortgage every month. One-third of her remaining budget is spent on recreational activities. Which equation below can be used to determine the amount, in dollars, spent on recreational activities? Divide. Express your answer in simplest form. 8/9 87 1/9 1/9 8/72 9 Someone help me with this please !!!!!:( Write the point-slope form of the given line that passes through the points (0, 3) and (4,0). Identify (x, y) as the X-Intercept of the line. Include your work in your final answer. Type your answer in the box provided to submit yoursolution. Many of the voters who supported Democrats were __________. -28+4x=4(x-7) how many solutions marking brainlest The BEST way to figure out how an online course is organized is to:check the syllabusmessage the teacherask other students,research it online, Example sentencePlease vote! Your opinions matter.What does matter mean in this sentence? What is an equation of the function shown in the graph?O A. y = 3x - 12O B. y = 1x +3O C. y= 1x - 12O D. y = 4x + 3PLEASE HELP ME!! The distance from Leoti, Kansas to Dighton, Kansas on the map is approximately 2.5 inches. The key to the map states that 1 inch is equal to 20 miles. Which of the following best approximates the distance from Leoti to Dighton? Which of the following is not one of the views available in the PowerPoint application?Show ViewSlide SorterNotes PageReading Pane which increased as a result of the industrial revolution?(check all that apply).A. greenhouse gas emissionsB. gaps in global wealthC. toxic wasteD. urbanization Which of the following characters from The Diary of Anne Frank would be an example of a flat character?AnnePeterMargotMrs. Frank A new basketball 20% off if its original price and is now selling for $36 what is the original price of the basketball before the sale? In a short paragraph, describe two examples ofhow changes to the railroad helped Americanindustries to grow. What does the director do to add to the mood and tone of The Diary of Anne Frank? will give BRAINLIEST! 23. What is one meaning of the term "Nuyorican"? (1 point)someone of Puerto Rican descent born outside of Puerto Ricoa native Puerto Ricansomeone of Dominican descent born outside of the Dominican Republicall Puerto Ricans who live in the United States