Prove that :-

[tex] \quad \leadsto \quad \bf \zeta ( z ) = \displaystyle \bf \sum_{\bf n=1}^{\infty} \bf \dfrac{1}{n^x} \cdot e^{-iy \cdot log ( n )} [/tex]

Where , z = x + yi

Riemann Hypothesis :) ​

Answers

Answer 1

We have

[tex]e^{-iy \log(n)} = e^{\log(n^{-iy})} = n^{-iy}[/tex]

and

[tex]\dfrac1{n^x} \cdot e^{-iy \log(n)} = \dfrac{n^{-iy}}{n^x} = \dfrac1{n^{x+iy}} = \dfrac1{n^z}[/tex]

The sum

[tex]\displaystyle \sum_{n=1}^\infty \frac1{n^z}[/tex]

is exactly the definition of the Riemann zeta function [tex]\zeta(z)[/tex].


Related Questions

Math question please help

Answers

Answer: The answer for 9 is 50 miles per hour and the one who drove farthest is is ben because at 5 hours he drove already 250 miles. And for number 9 according to the table she is driving 15 miles per hour because on the bottom it always adds up by 15 miles.

Step-by-step explanation: So first to figure out 9 I used y2-y1/x2-x1 to figure out the rate of change and got 50 miles per hour and the point I used were (5,100) and (5,250). Then According to Ben's graph it shows that he drove 250 miles at 5 hours while sally was at 100 miles for 5 hours. So Ben drove the farthest. Then finally for number 9 I concluded that sally is driving 15 miles per hour because distance always adds up by 15 miles.

Hope this Helps :D

. Find the sum of the sequence.
31 +32 +33 +34 + ... + 122

Answers

Answer: 252

Step-by-step explanation:

Answer: 252


Explanation

write all the numbers less than 100 which are common multiples of 3 and 4

Answers

Answer:

12, 24, 36, 48, 60, 72, 84, 96

Step-by-step explanation:

The smallest natural number that is a common multiple of 3 and 4 is 12. The answer is all multiples of 12 less than 100.

Answer: 12, 24, 36, 48, 60, 72, 84, 96

Given the diagram of the right angle below, find the value for x. Enter a number only.
(12x-30)° (3x)°

Answers

Answer:

x= 8

Step-by-step explanation:

Sum of the two angles = 90

12x - 30 + 3x = 90

15x -30 = 90

15x = 90 + 30

15x = 120

x = 120/15 = 8

HELP, URGENT! 18 points+brainliest
Use the inequality to answer Parts 1-3.
−3(x−2)≤[tex]\frac{1}{3}[/tex]

Part 1: Solve the inequality. Leave answer in terms of a whole number or reduced improper fraction.

Part 2: Write a verbal statement describing the solution to the inequality.

Part 3: Verify your solution to the inequality using two elements of the solution set.

Answers

The solution to the given inequality -3(x - 2) ≤ 1/3 is x ≤ 17/9

How to solve inequality

-3(x - 2) ≤ 1/3

open parenthesis

-3x + 6 ≤ 1/3

collect like terms

-3x ≤ 1/3 - 6

-3x ≤ (1-18) / 3

-3x ≤ -17/3

divide both sides by -3

x ≤ -17 /3 ÷ -3

x ≤ -17/3 × 1/-3

x ≤ -17/-9

x ≤ 17/9

A verbal statement describing the solution to the inequality is x is less than equal to 17 over 9

Verifying the solution of the inequality:

-3(x - 2) ≤ 1/3

-3x + 6 ≤ 1/3

-3(17/9) + 6 ≤ 1/3

-51/9 + 6 ≤ 1/3

(-51+54) / 9 ≤ 1/3

3/9 ≤ 1/3

1/3 ≤ 1/3

Therefore, the -3(x - 2) ≤ 1/3 to the inequality -3(x - 2) ≤ 1/3 in verbal statement is x is less than equal to 17 over 9.

Read more about inequality:

https://brainly.com/question/25275758

#SPJ1

Mahad had no marbles, so Sara gave ⅓ of her marbles to Mahad. How many marbles does Mahad have?

What is missing from this problem for you to solve it?
Your answer:

Answers

The missing part from this problem for you to solve it is that the total marbles Sara had.

What is the unitary method?

The unitary method is a method for solving a problem by the first value of a single unit and then finding the value by multiplying the single value.

If an event can occur in m different ways and if following it, a second event can occur in n different ways, then the two events in succession can occur in m × n different ways.

We have been given that Mahad had no marbles, so Sara gave ⅓ of her marbles to Mahad.

Here we can see that this problem cannot be solved due to a lack of information. we need the total marbles Sara had.

If we are given the total marbles Sara had, then we can just simply divide the amount by the denominator.

Therefore, the missing part from this problem for you to solve it is that the total marbles Sara had.

To learn more about the unitary method, please visit the link given below;

https://brainly.com/question/23423168

#SPJ1

The height of a box is 9 inches. The length is three inches more than the width. Find the width of the volume is 1170

Answers

The volume of a cuboid or box is the multiplication of length, width, and height by that expression the width of the given cuboid box is 10 inches.

What is volume?

Volume is the scalar quantity of any object that specified occupied space in 3D.

For example, the space in our room is referred to as volume.

The volume of cuboid = length × height × width.

Given that,

Height (H) = 9 inches.

The length is three inches more than the width.

So,

L = 3 + W

Now,

Volume of box = 1170 inches³

Now,

The volume of the cuboid is given as

V = L×W×H

1170 = (3 + W) × W×9

W² + 3W - 130 = 0

W² + 13W - 10W - 130 = 0

W(W + 13) - 10(W + 13) = 0

(W + 13)(W - 10) = 0

W = 10,-13 since the length can never be negative so 10 inches will be right.

Hence "The width of the given cuboid box is 10 inches".

To learn more about volume,

https://brainly.com/question/1578538

#SPJ1

-
Given f(x)=x³ + 2x² – 3x −6, what is f(−2)?

Answers

Step-by-step explanation:

f(x) = + 2x² - 3x - 6

f(-2) = (-2)³ + 2(-2)² - 3(-2) - 6

= -8 + 8 + 6 - 6

= 0

(4x² - 9)(3x² + 4x) = 0

Answers

Answer:

The answer is in the attached screenshot.

find three solutions for the linear equation 4x-3y=1,and plot the solution as points on a coordinate plane

Answers

The Three solutions for the linear equation are: (0, -0.333), (1,1) and (3, 3.667).

According to the statement

We have to find that the solution of the linear equation.

So, For this purpose, we know that the

A linear equation is defined as an equation that is written in the form of Ax+By=C.

From the given information:

The three solutions for the linear equation 4x-3y = 1.

Then

The given equation is :

4x-3y = 1

Slope intercept form is

y = 4/3x - 1/3.

Then

For x = 0, we have that

y = 4/3x - 1/3.

y = 4/3(0) - 1/3.

y =  - 1/3.

y = -0.334

Then

For x = 1, we have that

y = 4/3x - 1/3.

y = 4/3(1) - 1/3.

y =  3/3.

y = 1.

Then

For x = 3, we have that

y = 4/3x - 1/3.

y = 4/3(3) - 1/3.

y =  11/3.

y = 3.67.

So, The Three solutions for the linear equation are: (0, -0.333), (1,1) and (3, 3.667).

Learn more about linear equation here

https://brainly.com/question/4074386

#SPJ9

Alexandra Efland has a savings account that earns 5.5% interest compounded daily. On May 5, the amount in the account was $28,214.35. How much interest will the money earn in the next 90 days?

Use the formula: where

A = Amount

P = Principal

r = rate

n = number of periods

t = time in years

Group of answer choices

$38.57

$285.71

$385.21

$901.15

Answers

The interest earned in next 90 days is  $390.6.

What is Compound Interest?

The amount of money earned, in compound interest, after t years, is given by:

A= P[tex]( 1+ r/n)^{(nt)}[/tex]

Given:

A = Amount

P = Principal = $28,214.35

r = rate = 0.055

n = number of periods=365

t = time in years=3/12= 1/4

Using compound interest formula

A= P[tex]( 1+ r/n)^{(nt)}[/tex]

A(90)=  28,604.95[tex]( 1 + 0.055/365)^{(365 * 1/4)}[/tex]

A(90)=28241.35 [tex](1.00015)^{(91.25)}[/tex]

A(90)=  $28,604.95

So, the interest earned in next 90 days is

=28,604.95 - 28,604.95

= $390.6

Learn more about compound interest here:

https://brainly.com/question/28148801

#SPJ1

A person has a bag containing quarters and dimes. There are a total of 185 coins in the bag, and the total value of the coins is $26.75.

Answers

Step-by-step explanation:

and ... ? what do we need to do ?

I guess finding the number of quarters and dimes.

x = number of quarters

y = number of dimes

x + y = 185

x = 185 - y

0.25×x + 0.1×y = 26.75

after all, a quarter has a value of $0.25, and a dime of $0.10.

let's use the identity of the first equation in the second equation :

0.25×(185 - y) + 0.1×y = 26.75

to make is simpler to see let's multiply the whole thing by 100 :

25×(185 - y) + 10y = 2675

4625 - 25y + 10y = 2675

4625 - 15y = 2675

1950 = 15y

y = 130

x = 185 - y = 185 - 130 = 55

there are 55 quarters and 130 dimes in the bag.

What is the answer and the steps for 1-3?

Answers

Answer:

Step-by-step explanation:

Background: f(x) is the same thing as y but represents the value of x in parentheses.

Ej: f(2)=3x+2, this solution would be "8" because the value in the parentheses represents the value of x. (if the parentheses have an "x" then the value of x is unknown.

1.

f(x)=5x+8   g(x)=(x-8)/5

f(g(x))=?, 5((x-8)/5)+8

f(g(x))=x-8+8

f(g(x))=x

g(f(x))=5x+8-8/5

g(f(x))=5x/5

g(f(x))=x

g(f(x))=f(g(x)) because they both equal x proving they are inverses

Sorry, I don't have time to answer the rest of the steps (I will give the answers to check the work).

All of them are x=x because they are all inverse functions.

what is the value of g(4)

Answers

The value of g(4) is 7 when given function is g(x)= 4x-9 .

By considering the given function

g(x)= 4x-9

g(4)=4(4)-9

g(4)=16-9

g(4)=7

A function in mathematics that goes from a set X to a set Y assigns exactly one element of Y to each element of X. The sets X and Y are referred to as the function's domain and codomain, respectively.

a mathematical expression, rule, or law that establishes the relationship between an independent variable and a dependent variable (the dependent variable). Functions are everywhere in mathematics, and they are essential for constructing physical relationships in the sciences.

Learn more about functions here

https://brainly.com/question/25638609

#SPJ9

Alina is stocking up on energy drinks to stay alert while studying for exams. The store sells energy drinks in 4-packs for $11.60. They will also sell single drinks for
1
4
1
4
the cost of a 4-pack. How many energy drinks can she buy for $84.10?
Fill in this table first, then use the table to answer the question.

Answers

4 drinks = 11.60
1 drink = 2.90
28 drinks = 81.20
29 drinks = 84.10

So 29 energy drinks

Hope this helps :)

Please help! Will give 60 points!

Answers

X+20-1 X->1
9+20-1
29-1
28

So the answer would be 28

Answer:

a) 28

Step-by-step explanation:

Given information,

→ w = 5

→ x = 9

→ y = 2

The given expression is,

→ x + 20 - 1

Let's solve the expression,

→ x + 20 - 1

→ 9 + 20 - 1

→ 29 - 1

→ 28

Hence, the answer is 28.

Fill in the table for the function.

Answers

The table of the function y = (1/2)x + 3 is when (x = 4, y = 5), (x = 6, y = 6),

( x = 9, y = 15/2), ( x = 11, y = 17/3).

What is an expression?

An expression represents that two different forms of numerical and variables are the same.

Given an expression y = (1/2)x + 3 we have to determine the range of this function corresponding to the domain { 4, 6, 9, 11 }.

For x = 4,

y = (1/2).4 + 3.

y = 2 + 3.

y = 5.

For x = 6,

y = (1/2).6 + 3.

y = 3 + 3.

y = 6.

For x = 9,

y = (1/2).9 + 3.

y = 9/2 + 3.

y = 15/2.

For x = 11,

y = (1/2).11 + 3.

y = 11/2 + 3.

y = 17/3.

learn more about expression here :

https://brainly.com/question/16804733

#SPJ1

If the per capita growth rate of the world population continues to be what it was in the year 2016, the world population t years after July 1, 2016, will be
7.4 ✕ 1.011t billion.
According to this formula, when will the world population reach 8 billion?
2019
2022
2023
2026

Answers

According to this formula, the time when the world population reach 8 billion is D. 2026.

How to illustrate the information?

From the information given, the capita growth rate of the world population continues to be what it was in the year 2016, the world population t years after July 1, 2016, will be 7.4 ✕ 1.011t billion.

Therefore, the year when the world population reach 8 billion will be:

80 billion = 7.4 × 1.011t billion

1.011t = 80/7.4

1.011t = 10.8

t = 10.8/1.011

t = 10

Therefore, the number of years will be added. This will be:

= 2016 + 10

= 2026

Learn more about population on:

brainly.com/question/25896797

#SPJ1

If pentagon jklmn is similiar to vexyz what is angle
X

Answers

The measurement of the angle X is 60 degrees.

Angles L and X are the highest angles according to the diagram. They line up to have an angle of L = X = 60 degrees.

However, because the figures in a diagram could be oddly arranged, you shouldn't rely exclusively on it. A more effective strategy is to consider the letter combinations JKLMN and VWXYZ.

Observe how the third letters of JKLMN and VWXYZ, respectively, are L and X. This indicates that the letters are congruent angles and couple up (since the polygons are similar). Thus, this is a non-visual method of understanding how angle L = angle X = 60.

Learn more about angles here :

https://brainly.com/question/28451077

#SPJ9

2.4 (x - 6) = 0.4 (x + 8) + 12
Answer: x = ?

Please give an answer WITH step by step to receive brainlist and 100 points. If only an answer is given with no explanation it will be reported.

Thank you!

Answers

The solution to the linear equation given as 2.4 (x - 6) = 0.4 (x + 8) + 12 is  x = 14.8

What are linear equations?

Linear equations are equations that have constant average rates of change.

Note that the constant average rates of change can also be regarded as the slope or the gradient

How to solve the linear equation?

The linear equation is given as

2.4 (x - 6) = 0.4 (x + 8) + 12

Open the brackets

So, we have

2.4x - 14.4 = 0.4x + 3.2 + 12

Collect the like terms in the above expression

So, we have

2.4x - 0.4x = 14.4 + 3.2 + 12

Evaluate the like terms in the above expression

So, we have

2.0x = 29.6

Evaluate the quotient in the above expression

So, we have

x = 14.8

Hence the solution to the linear equation given as 2.4 (x - 6) = 0.4 (x + 8) + 12 is  x = 14.8

Read more about linear equation at

https://brainly.com/question/4074386

#SPJ1

Please Help!!!

Indicate the equation of the given line in standard form.
The line that is perpendicular bisector of the segment whose endpoints are R(-1, 6) and S(5, 5)

Answers

The equation of the line in standard form is 12x-2y=13.

Given that line that is the perpendicular bisector of the segment whose endpoints are R(-1, 6) and S(5, 5).

R≡(-1,6) and S≡(5,5)

The perpendicular bisector of the line segment joining R and S will pass through the midpoint M.

coordinate of M is =((-1+5)/2,(6+5)/2)

coordinate of M is=(2,11/2)

Slope of the line joining R and S is

m₁=(6-5)/(-1-5)

m₁=-1/6

We know that for two perpendicular lines having slope m₁ and m₂,

m₁m₂=-1

Here, m₁=-1/6

Let m₂ be the slope of the perpendicular bisector

(-1/6)m₂=-1

m₂=6

Equation of the perpendicular bisector will be,

(y-yₙ)/(x-xₙ)=m₂   [(xₙ,yₙ) is the coordinate of M]

(y-11/2)/(x-2)=6

(2y-11)/2=6(x-2)

2y-11=12x-24

12x-2y=13

Hence, the equation of the given line in standard form when ine that is perpendicular bisector of the segment whose endpoints are R(-1, 6) and S(5, 5) is 12x-2y=13.

Learn more about the equation of line from here brainly.com/question/22443778

#SPJ9

the art class has blue cloth that is 60 inches long, gold cloth that is 48 inches long, and white cloth that is 72 inches long. they want to cut all the cloth into pieces of equal length for a project. what is the greatest possible length of the pieces without having any cloth left over

Answers

Answer:

Solution:

So answer is 12 inches

Help please !! Need it to be a fraction :))

Answers

Answer: 1/6

Step-by-step explanation:

pls help my earlier question was deleted

Answers

Based on the given equation, the solution to x is -32.

What is x?

The formula given is:

x / -2² = 4 (-2)

To solve for x, solve for the exponents:

x / -2² = 4 (-2)

x / 4 = 4 (-2)

Then solve the brackets:

x / 4 = 4 (-2)

x / 4 = -8

Then solve for x:

x / 4 = -8

x = -8 x 4

x = -32

In conclusion, based on the equation of x given, the value of x can be found to be -32.

Find out more on solving for x at https://brainly.com/question/25678139

#SPJ1

is company name, state and age a categorical variable?

Answers

Answer:

yes

Step-by-step explanation:

you can classify people into categories by name, state, and age. Hope this helps!

A company is considering a new product launch. There is a 0.6 chance that demand for the product will be strong and a 0.4 chance that demand will be weak. Two strategies for the launch are possible: 1 has high promotion costs and a net cash outflow of K120 000 if demand proves to be strong, and if demand proves weak a net cash outflow of (K30 000) will result. Strategy 2 has low promotion costs and if demand is strong will generate a cash inflow of only K80 000 but with weak demand a net cash inflow of K20 000.


i. Draw a decision tree and advise which course of action generates the greatest expected profit.
ii. What is the maximum amount that should be paid for market research to determine with certainty whether demand will be strong or weak?

Answers

Strategy 2 will generate higher expected profit and the company should invest k 8000 for market research to determine with certainty whether demand will be strong or weak.

                                       →Strong demand (P= 0.6) k12000 outflow

                                   →|

                                       →Weak demand (P=0.4) k30000 outflow

New product launch   ║

                                       →Strong demand (P= 0.6) k80000 outflow

                                    →|

                                       →Weak demand (P=0.4) k20000 outflow

Expected market value in strategy 1 is

= - 120000 x 0.6 + (-30000) x 0.4

= -k 84000

Expected market value in strategy 2 is

= - 80000 x 0.6 + 20000) x 0.4

= k 56000

Therefore strategy 2 will generate higher expected profit

In strategy 2

Expected value in strong demand is 80000 x 0.6 = k 48000

Expected value of weak demand is 20000 x 0.4 = k 8000

Thus the company should invest k 8000 for market research to determine with certainty whether demand will be strong or weak

To learn more about decision tree refer here

https://brainly.com/question/26675617

#SPJ9

0.25(x+10) = 2+0.5(x-1)

Answers

Step-by-step explanation:

0.25(x+10) = 2+0.5(x-1)

0.25 * x + 0.25 * 10 = 2.05 * x - 2.05 * 1

0.25x + 2.5 = 2.05x - 2.05

0.25x - 2.05x = -2.05 - 2.5

-1.8x = - 4.55

x = -4.55/-1.8

x = 2.53777777778

What IS the slope of the line that passes through the points (7, -6) and (6, -6)?
Write your answer in simplest form.

Answers

Answer:   0

Work Shown:

[tex](x_1,y_1) = (7,-6) \text{ and } (x_2,y_2) = (6,-6)\\\\m = \frac{y_{2} - y_{1}}{x_{2} - x_{1}}\\\\m = \frac{-6 - (-6)}{6 - 7}\\\\m = \frac{-6 + 6}{6 - 7}\\\\m = \frac{0}{-1}\\\\m = 0\\\\[/tex]

Lines with slope of 0 are always horizontal. The y coordinates are the same value.

The pay rate and hours worked are given below. Use this information to determine the following. Make sure to include decimals and appropriate zeros.

the gross pay
federal tax (assuming 20% of gross earnings)
state tax (assuming 6% of gross earnings)
social security deductions (assuming 7.05% of gross earnings)
group health insurance (assuming 13% of gross earnings)
pension deduction (assuming 6.5% of gross earnings)
total deductions
net pay
Earnings

Description Rate Hours Current
Regular 9.00 39.0
351.00

Answers

The net pay of the individual after having deducted total deductions is $166.54

How do we determine the amount of each deduction?

The amount of each deduction is based on the gross pay of $351.00, as a result, we simply multiply the percentage of deduction by the gross pay to determine the dollar amount of each deduction.

the gross pay=$351

federal tax (assuming 20% of gross earnings)=$351*20%=$70.20

state tax (assuming 6% of gross earnings)=$351*6%=$21.06

social security deductions (assuming 7.05% of gross earnings)=$351*7.05%=$24.75

group health insurance (assuming 13% of gross earnings)=$351*13%=$45.63

pension deduction (assuming 6.5% of gross earnings)=$351*6.5%=$22.82

total deductions=$70.20+$21.06+$24.75+$45.63+$22.82

total deductions=$184.46

net pay=$351-$184.46

net pay=$166.54

Find out more about deductions on:brainly.com/question/6778037

#SPJ1

i need help with the decimal sequences pls

Answers

6). 7.35, 6.6, 5.85, 5.1, 4.35
8). 1, 1.8, 2.6, 4.4, 6.2
10). 9.3, 7.5, 5.7, 3.9, 2.1
12). 2.7, 2.65, 2.6, 2.55, 2.5, 2.45
14. 6.1, 6.05, 6, 5.95, 5.9, 5.85
Other Questions
a customer of landen consulting company makes a $400 payment of cash on a bill for services provided last month. record the receipt of cash in the accounting equation of landen consulting by: (check all that apply.) The ethical principle of _____ has been violated if a researcher decides to place participants he finds more attractive into the experimental condition he believes has the greatest benefit. C) Compltez les phrases avec la forme correcte du FUTUR SIMPLE.1. J'vais (aller) la campagne. 2. Ils (tre) trs bien traits Marseille. 3. Ce lieu (faire) l'objet d'une vacuation totale. 4. Mes amis et moi (voir) le festival de Cannes. 5. On (emmener) ce malade l'hpital. 6. Vous (aller) la chasse demain matin. 7. Mon pre (regarder) un gros mouton lors de la Tabaski. 8. Tu (tre) un futur grand bonhomme. 9. Demain, nous (aller) la pche. 10 Mon frre (devoir) se rendre l'cole. 3. Bientt, nous (tre) tous tremps par la pluie. 4. Vous (avoir) bientt de mes nouvelles. 5. Pour tre l'heure, nous (courir) tout le long du chemin. 6. Demain, nous (s'inscrire) au club de judo. 7. Quand tu (vouloir) partir, tu nous le diras. 8. (savoir)-tu marcher jusque l-bas ? 9. Il (falloir) se lever tt demain matin. 10. Elles me raconteront leur voyage quand elles (venir). 11. Je lui (envoyer) une carte postale. 12. Quand tu auras l'argent, tu me (payer). 13. Venez vite, je vous (faire) une boisson chaude ! 14. Quand elle (voir) mes tableaux, elle va s'merveiller. 15. Je serai trs triste quand mon vieux chien (mourir). PLS HELP!A group of friends wants to go to the amusements part, they have no more than $235 to spend on parking and admission, Parking is $17.50 and tickets cost over $36.25 per person, including tax. Use the drop down menu below to write an inequality representing p, the number of people who can go to the amusement park.Which inequality or then what is Answerp (Inequality) _____ 3.EvaluateO-1616O-4O 132-12-2x-3y5for x = 2 and y = -4. decisions focus on how a company will spend its financial resources on long-term projects that ultimately determine whether the firm successfully creates value for its owners. 4. Four of the twelve members of the panel were late forthe meeting. What fraction of the members were ontime?A. 12B.4C. 13D.23 The driver of a car traveling at 10.0 m/s along a straight road depresses the accelerator and uniformly increases her speed at a rate of 2.00 m/s2. how fast will the car be moving as it passes a parked police cruiser 140 m away? The number of calories in an order of waffle fries is 20 more than the number of calories in 6 apples. If the waffle fries have 590 calories, what is the number of calories in 1 apple Why aren't more couples using birth control in zambia? Explain how and why various states of south and southeast asia developed and maintained power over time. What is each expression written as a single logarithm?a. log 5 x+log3 x Why is it important to identify structures in Prokaryotes that are different from Eukaryotes? help due today please What are the consequences to their organization when the leaders(managers) equate the concepts of power and authority? Membranes consist of many different types of fatty acids, which confer different properties, including membrane fluidity. Which of the following fatty acids is the LEAST adaptive to maintaining a fluid membrane at cold temperatures?a)Myristoleic CH3(CH2)3CH=CH(CH2)7COOHb)Arachidonic CH3(CH2)4CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH2)3COOHc) Caprylic CH3(CH2)6COOHd) Linoleic CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH . What was the significance of the "Middle Ground" In North America during the colonial period? a. Large numbers of escaped slaves from the Middle Colonies treated it as a haven and established a lasting settlement there. b. The British and the French respected it as Cherokee territory, creating a precedent for Native American land ownership. c. The discovery of precious metals elsewhere led to a drastic decline in the population of this area and a decrease of interest in the frontier. d. Caught in imperial rivalries between France, Spain, and England, it was viewed as a lush and promising location for future settlement by Anglo-American colonists. e. It was the preferred settlement area for crypto-Jews in North America and attracted many Spaniards. Read the passage from "Marriage Is a Private Affair" by Chinua Achebe. In this passage, Nnaemeka speaks first, and Nene speaks second."Yes. They are most unhappy if the engagement is not arranged by them. In our case its worseyou are not even an Ibo.This was said so seriously and so bluntly that Nene could not find speech immediately. In the cosmopolitan atmosphere of the city it had always seemed to her something of a joke that a persons tribe could determine whom he married.At last she said, "You dont really mean that he will object to your marrying me simply on that account? I had always thought you Ibos were kindly disposed to other people."So we are. But when it comes to marriage, well, its not quite so simple. And this, he added, "is not peculiar to the Ibos. If your father were alive and lived in the heart of Ibibio-land he would be exactly like my father."I dont know. But anyway, as your father is so fond of you, Im sure he will forgive you soon enough. Come on then, be a good boy and send him a nice lovely letter . . ."It would not be wise to break the news to him by writing. A letter will bring it upon him with a shock. Im quite sure about that.Which statement correctly analyzes this passage in terms of its historical context?Nene realizes immediately that her marriage to Nnaemeka will cause conflict in his family.Nene is surprised how different her values are from people who live far from a city.Nnaemeka does not understand how different Nenes values are from his familys.Neither Nnaemeka nor Nene believes that Nnaemeka's family will object to the marriage. During the 2006 Olympics a gymnastics receives the following scores: 8.9, 9.2, 9.15, 9.03. What is the gymnasts average score? The Evans family paid $1,800 for a new refrigerator, washer, and dryer. Therefrigerator cost $250 more than the washer. The dryer cost half as muchas the washer. How much did the washer cost?