During one month Andre used 785 gallons of water at his home. There are approximately 3.8 liters in 1 gallon.Which measurement is closest to the number of liters Andre used during this month?

Answers

Answer 1

The closest measurement to the number of liters Andre used during the month is 2,983 liters of water.

How is the measurement determined?

The measurement of the number of liters used is determined by multiplying the number of gallons of water by the approximate value of 1 gallon in liters.

Using one of the mathematical operations, multiplication, the conversion of the quantity of water from gallons to liters can be computed.

Data and Calculations:

The total number of gallons of water used = 785

Conversion of 1 gallon to liters = 3.8 liters per gallon

The total number of liters of water used = 2,983 (785 x 3.8)

Thus, the closest measurement to the number of liters Andre used during the month is 2,983 liters of water.

Learn more about mathematical operations at https://brainly.com/question/20628271

#SPJ1

Answer 2

Answer:

The answer is 2,983

Step-by-step explanation:


Related Questions

find the midpoint of points A(8,10)and B(0,5) graphically

Answers

Answer:

Step-by-step explanation:

Midpoint coordinates(x, y)  of 2 points (x1, y1) and (x2, y2) are given by
x = (x1 + x2)/2

y = (y1 + y2)/2

So in this situation

x = (8 + 0)/2 = 8/2 = 4

y = (10 + 5)/2 = 15/2 = 7.5

Midpoint is at (4, 7.5)

Check the graph attached

You score 84 points in 5 games. How many points do you score per game?

Answers

Answer:

16.8

Step-by-step explanation:

84 / 5 = 16.8

Answer:

17 points(Rough estimate)

Step-by-step explanation:

Using long division,

[tex]5|84\\5 \times 1 = 5\\8 - 5 = 3\\\mathrm{Drop~4~onto~3~to~get~34}\\5 \times 6 = 30\\34 - 30 = 4[/tex]

Round 16 to nearest ones place

[tex]\mathrm 16 = 17[/tex]

Therefore,

You scored ≈ 17 points per game out of 5 games.

if you need the exact value, it's 16.8

Any concerns, let me know. Have a good day!

ZA and ZB are supplementary angles. If m/A= (2x - 20)° and m
LB = (3x+15)°, then find the measure of ZB.

Answers

The required measure for the supplementary angles EB is calculated as 126°.

Given that,
Two supplementary angles are given ZA and ZB.
ZA = 2x - 20 ; ZB = 3x + 15

To determine the measure of ZB.

What is simplification?

The process in mathematics to operate and interpret the function to make the function or expression simple or more understandable is called simplifying and the process is called simplification.

Here,
The sum of the supplementary angle is 180°.
ZA + ZB = 180°
2x - 20 + 3x + 15 = 180
5x - 5 = 180
5x = 180 + 5
5x = 185
x = 37
Now,
the measure of angle,
ZB = 3x + 15
ZB = 3 * 37 + 15
ZB = 126°

Thus, the required measure of the angle EB is 126°.


Learn more about simplification here:
https://brainly.com/question/12501526
#SPJ1


Let f(x)=2 x+5 and g(x)=x²-3 x+2 . Perform each function operation, and then find the domain.
f(x)-2 g(x)

Answers

The values for f(x)-2 g(x) = -2x² + 8x - 1

What are the domain of the function  f(x)-2 g(x)?

Given :  f(x)=2 x+5

            g(x)=x²-3 x+2

Solution:

            2g(x)=2x²-6x+4

            f(x)-2 g(x) = 2 x+5 - (2x²-6x+4)

            f(x)-2 g(x) = 2 x+5 - 2x² + 6x - 4

            f(x)-2 g(x) = -2x² + 8x - 1

To learn more about the domain, visit;

https://brainly.com/question/956872

#SPJ4

HELP!! 30 POINTS!
The sum of three consecutive integers is -51. Find the value of the greatest of the three.

Answer:

Answers

Answer: 16, 17, and 18.

Step-by-step explanation: What I'll do I'll just let explain how to solve it and that will instantly solve your question!

The first case of business to make things easier would be to try and put this on a linear equation so...

Let the first integer be x.

Then the next consecutive two integers will be x + 1 and x + 2

x + (x + 1) + (x + 2) = 51 [Sum of the 3 consecutive integers is 51]

-> 3x + 3 = 51

-> 3x = 51 - 3

-> 3x = 48

-> x = 48/3

-> x = 16,

Thus, x + 1 = 17, x + 2 = 18

Therefore, the three consecutive integers are 16, 17, and 18.

Hope it helps ^^

show that theorem 2.6, the additive law of probability, holds for conditional probabilities. that is, if a, b, and c are events such that p(c) > 0, prove that p(a ∪ b|c)

Answers

P(AUB|C)=P(A|C) + P(B|C) - P(AnB|C) is the correct answer.

From distributive law we have,

P((AUB)nC)=P(AnC) + P(BnC)-P(AnBnC)

Dividing both sides by P(C)

P((AUB)nC)/P(C)=P(AnC)/P(C) + P(BnC)/P(C) - P(AnBnC)/P(C)

P(AUB|C)=P(A|C) + P(B|C) - P(AnB|C)

For more information on additive law click on the link below:

https://brainly.com/question/27791673

#SPJ4

There were four hundred fifty-seven employees working in an office building. fifty-two of them left to go have lunch. 204 cars are still in the parking lot. how many emplyees are left in the building

Answers

The correct answer is 405

The number below is not correctly written in scientific notation.

0.0038 × 105
What is the new exponent for the power of 10 after rewriting the number correctly in scientific notation?

3.8 × 10?

Write the new exponent value in the blank below.

Answers

Answer: use a picture math thing

Step-by-step explanation:0.0038 x 105=0.399 so move the decimal point over 1 then it should look like 0.038 x 10.5=0.399 then repeat.

The coordinated of point T are (0,4). The midpoint of ST is (4,-5). Find the coordinates of point S

Answers

Answer:

(8,-14)

Step-by-step explanation:

mid piont is (4,-5) So let us consider that S(x,y)

Now,

from mid point formula,

[tex]4 = \frac{x + 0}{2} \\ x = 8[/tex]

[tex] - 5 = \frac{y + 4}{2} \\ - 10 = y + 4 \\ y = - 10 - 4 \\ y = - 14[/tex]

Kym is renovating the first floor of her house. She bought 750 square feet of laminate flooring and 525 square
feet of carpet and paid $2717.25. She went back to the store and bought an additional 100 square feet of
laminate flooring and 75 square feet of carpet and paid $374.75. Find the cost per square foot of each type of
flooring. equation

Answers

Using simultaneous equations in two variables we get that the cost of laminate is $ 0.65 per sq. feet and the cost of carpet is $ 4.12 per sq. feet.

Equations in algebra that involve two or more variables simultaneously, such as x and y, are referred to as simultaneous equations. The equations are referred to as simultaneous equations since they are solved simultaneously. There are countless possible solutions to just these equations.

A set of finite equations for which common solutions are sought makes up a system of equations, often known as an equation system.

Let the cost per sq feet of laminate be x and the cost per sq feet of carpet be y.

Now it is given that the cost of 750 sq feet of laminate and 525 square foot of carpet is $2717.25

∴ 750x+525y=2717.25

Again  the cost of 100 sq feet of laminate and 75 square foot of carpet is $374.75

∴ 100x + 75 y = 374.15

Now we solve the pair of simultaneous equations to find the value of x and y:

Multiplying the second equation by 7 and subtracting from the first we get:

750x + 525y =  2717.25

600x + 575 y = 2619.05

150x = 98.20

or, x = 0.654...

Substituting this  value in the first equation we get:

y= 4.115...

Therefore the solution of the simultaneous equation is:

x = $ 0.65 and y = $ 4.12

Therefore  the cost of laminate is $ 0.65 per sq. feet and the cost of carpet is $ 4.12 per sq. feet.

To learn more about simultaneous equations visit:

https://brainly.com/question/16763389

#SPJ1

Please Help, Consider the following sets in the universal set U, which is the set of all elements of the three given sets below. List the elements of the sets being described.
B = {d, o, I, e} I = {p, i, n, a, y} J = {p, i, n, o, y}

Answers

The solutions are;

1. U = {a, d, e, i, l, n, o, p, y}

2. E ∪ I = {a, d, e, i, l, n, o, p, y}

3. E ∩ I = { }

4. J' = {a, d, e, l}

5. I ∪ J = {p, i, n, a, o, y}

6.( J ∩ I ) ∪ E = {d, o, l, e, p, i, n, y}

7. E' = {a, i, n, p, y}

8. I' ∪ J = {d, e, l, o, p, i, n, y}

9. (E ∩ I) ∩ (I ∪ J) = { }

10. (J ∪ I)' = {d, e, l}

What is Union of the set?

Union of two or more set is the set containing all the elements of the given set.

Here, U is the universal set, which is the set of all elements of the three given sets.

And, Three sets are;

⇒ E = {d, o, I, e},     I = {p, i, n, a, y},     J = {p, i, n, o, y}

Now, We find the universal set as;

1. U = {{a, d, e, i, l, n, o, p, y}

2. And, E ∪ I =  {d, o, I, e} ∪ {p, i, n, a, y}

                = {a, d, e, i, l, n, o, p, y}

Hence, E ∪ I = {a, d, e, i, l, n, o, p, y}

3.  E ∩ I =  {d, o, I, e} ∩ {p, i, n, a, y}

Since, It cannot contain any common elements.

So, Intersection of E and I is null set.

Hence, E ∩ I = { }

4. Since, J' = U - J

J' = {a, d, e, i, l, n, o, p, y} - {p, i, n, o, y}

J' = {a, d, e, l}

Hence, J' = {a, d, e, l}

5. I ∪ J = {p, i, n, a, y} ∪ {p, i, n, o, y}

           = {p, i, n, a, o, y}

Hence,  I ∪ J = {p, i, n, a, o, y}

6. ( J ∩ I ) ∪ E = ({p, i, n, o, y} ∩ {p, i, n, a, y}) ∪ {d, o, I, e}

                     = {p, i, n, y} ∪ {d, o, I, e}

                     = {d, o, l, e, p, i, n, y}

Hence, ( J ∩ I ) ∪ E = {d, o, l, e, p, i, n, y}

7.  E' = U - E

       = {a, d, e, i, l, n, o, p, y} - {d, o, I, e}

       = {a, i, n, p, y}

Hence, E' = {a, i, n, p, y}

8.  I' ∪ J = (U - I) ∪ J

            = ( {a, d, e, i, l, n, o, p, y} - {p, i, n, a, y}) ∪ {p, i, n, o, y}

            = {d, e, l, o} ∪ {p, i, n, o, y}

            =  {d, e, l, o, p, i, n, y}

Hence, I' ∪ J = {d, e, l, o, p, i, n, y}

9. (E ∩ I) ∩ (I ∪ J) = ( {d, o, I, e} ∩ {p, i, n, a, y}) ∩ ({p, i, n, a, y} ∪ {p, i, n, o, y})

                          = { } ∩ {p, i, n, a, o, y}

                          = { }

Hence,  (E ∩ I) ∩ (I ∪ J) = { }

10. (J ∪ I)' = U - (J ∪ I)

              = {a, d, e, i, l, n, o, p, y} - ({p, i, n, a, y} ∪ {p, i, n, o, y})

              = {a, d, e, i, l, n, o, p, y} - {p, i, n, a, o, y}

              =  {d, e, l}

Hence,  (J ∪ I)' = {d, e, l}

So, The solutions are;

1. U = {a, d, e, i, l, n, o, p, y}

2. E ∪ I = {a, d, e, i, l, n, o, p, y}

3. E ∩ I = { }

4. J' = {a, d, e, l}

5. I ∪ J = {p, i, n, a, o, y}

6.( J ∩ I ) ∪ E = {d, o, l, e, p, i, n, y}

7. E' = {a, i, n, p, y}

8. I' ∪ J = {d, e, l, o, p, i, n, y}

9. (E ∩ I) ∩ (I ∪ J) = { }

10. (J ∪ I)' = {d, e, l}

Learn more about the union of set visit:

https://brainly.com/question/1441698

#SPJ1

What’s 181 x 42 step by step

Answers

answer: 7,602

explanation: 2×3×7×181

Answer:7602

Step-by-step explanation:First line up the numbers vertically and match the places from the right like this.

181

942

* ​____

Now multiply the first number with the 1 st  digit in 2 nd

 number to get intermediate results. That is Multiply 181 with 2. Write the result 362 at the end leaving 0 spaces to the right like this.

181

42

*​_____

362

Now multiply the first number with the 2nd digit in 2nd

 number to get intermediate results. That is Multiply 181 with 4. Write the result 724 at the end leaving 1 spaces to the right like this.

181

42

*______

362

724

​______-

Now add the intermediate results to get final answer.

181

42

*_____

362

724

______

​7602

The probability mass function of a binomial distribution is given as

Select one:

a. 1x! ℮-λ λx

b. n!x!n-x! px (1-p)n-x

c. px (1-p)n-x

d. ℮-λ λx

Answers

The probability mass function of the binomial distribution is given by:

B. [tex]\frac{n!}{x!(n-x)!} \times p^{x} \times (1-p)^{n-x}[/tex]

What is the binomial distribution formula?

The formula is:

[tex]P(X = x) = C_{n,x}.p^{x}.(1-p)^{n-x}[/tex]

[tex]C_{n,x} = \frac{n!}{x!(n-x)!}[/tex]

The parameters are:

x is the number of successes.n is the number of trials.p is the probability of a success on a single trial.

Hence, considering the combination formula, the probability mass function of the binomial distribution is given by:

B. [tex]\frac{n!}{x!(n-x)!} \times p^{x} \times (1-p)^{n-x}[/tex]

More can be learned about the binomial distribution at https://brainly.com/question/24863377

#SPJ1


Anursery owner buys 8 panes of glass to fix some damage to his greenhouse. The 8 panes cost $18 80. Unfortunately, he breaks 3 more panes while repaining the damage. What is the cost of another
3 panes of glass?
Another 3 panes of glass cost:

Answers

Answer:

Step-by-step explanation:

If 8 panes cost 1880

then 1 pane cost 1880 divided by 8

1 pane = $ 235

3 pane = $235 x 3

            = $ 705

$1715 + $705 = $ 2420

Solve this linear quadratic system

y = 3x + 4
y + x² = 0

Answers

Answer:

x = -1, y = 1

Step-by-step explanation:

Solve the following system:

{y = 3 x + 4 | (equation 1)

y = x + 2 | (equation 2)

Express the system in standard form:

{-(3 x) + y = 4 | (equation 1)

-x + y = 2 | (equation 2)

Subtract 1/3 × (equation 1) from equation 2:

{-(3 x) + y = 4 | (equation 1)

0 x + (2 y)/3 = 2/3 | (equation 2)

Multiply equation 2 by 3/2:

{-(3 x) + y = 4 | (equation 1)

0 x + y = 1 | (equation 2)

Subtract equation 2 from equation 1:

{-(3 x) + 0 y = 3 | (equation 1)

0 x + y = 1 | (equation 2)

Divide equation 1 by -3:

{x + 0 y = -1 | (equation 1)

0 x + y = 1 | (equation 2)

Collect results:

Answer: {x = -1, y = 1

Based on the stemplot, which of the following is a correct comparison of the eastern and western states’ expenditures?

Answers

Going by the stemplot, a correct comparison to make between eastern and western states’ expenditures is The eastern states have, on average, a higher per-pupil expenditure than the western states.

How to read a stemplot?

Reading a stemplot requires looking at the stem first which is the number in the middle. Then combine this with the leaf to find the actual number. For instance, a stem of 7 and a leaf of 6 in the attached photo is $76,000.

From the attached photo, we see that the Eastern states have more numbers of per-pupil expenditure which means that on average, they have a higher per-pupil expenditure than the western states.

Options for this question are:

The western states exhibit more variability in their expenditures than the eastern states. The eastern states have, on average, a higher per-pupil expenditure than the western states. The distribution of per-pupil expenditures in the eastern states is more symmetric than the distribution of the western states. The distribution of the western states' per-pupil expenditure is skewed left, while the distribution of the eastern states' per-pupil expenditure is skewed right. Valid conclusions comparing the distributions cannot be made, since there is a different number of states in each group.

Find out more on stemplots at https://brainly.com/question/22400218

#SPJ1

Please Help! Determine the range of the following graph:

Answers

Answer:

- 4 ≤ y ≤ 2 or [ -4; 2 ]

Step-by-step explanation:

The range of the function is the set of all y- values.

The range on the graph can be determined by minimum and maximum points if the graph is continuous.

Looking at the given graph we observe:

The minimum is y = - 4,The maximum is y = 2,The graph is continuous between these two points.

The range is:

- 4 ≤ y ≤ 2 or[ -4; 2 ]

simplify completely 5√28+√63

Answers

The expression is completely simplified to give 13√7

What are surds?

Surds are defined as square root values that cannot be further decreases to integers or whole numbers.

Another name for surds are irrational numbers.

Given the surd forms;

5√28 + √63

Now, let's find the factors of the value 28 with perfect squares.

√28 = √4 × 7

The factors of 63 with perfect squares

√63 = √9 × 7

Now, let's substitute the values

5√4 × 7 + √9 × 7

Find the perfect squares

5 × 2√7 + 3√7

Multiply through

10√7 + 3√7

Since the values have common roots, add the coefficient and keep the root the same.

We have;

13√7

Thus, the expression is completely simplified to give 13√7

Learn more about surds here:

https://brainly.com/question/840021

#SPJ1

F(2x) graph and domain and range

Answers

The domain of the expression is all real numbers except where the expression is undefined. In this case, there is no real number that makes the expression undefined.

Interval Notation:

                             ( -∞ , ∞ )

Set-Builder Notation:

                                  { x | x ∈ R }

The range is the set of all valid  y  values. Use the graph to find the range.

Interval Notation:

                               ( -∞ , ∞ )

Set-Builder Notation:

                                 { y | y ∈ R }

Determine the domain and range.

Domain:  ( −∞ , ∞ ), { x | x ∈ R }

Range:  ( −∞ , ∞ ), { y | y ∈ R }

Learn more about event correlation here: brainly.com/question/24457122

#SPJ9

3(w-2)=9 please
answer

Answers

Answer:

w=5

Step-by-step explanation:

3(w-2)=9

3w-6=9

w=5

Answer:

w = 5

Step-by-step explanation:

The equation is 3(w - 2) = 9
1st : Distribute 3 to w and -2
    Should equal 3w and -6
2nd : Add 6 on both sides
    Should equal 3w = 15
3rd : Divide 3 on both sides
    Should equal w = 5

Hope this helps!
--Blu


For each annual rate of change, find the corresponding growth or decay factor. +0.1%

Answers

The growth factor for the annual rate of change +0.1 % is 1.001.

A quantity must vary by a specific percentage each time period in order for growth or decay to be exponential.

With the function displayed to the right, you may represent exponential growth or decay.

A(x) = a( 1 + r)ˣ

Where A is the amount after x time periods, a is the initial amount, x is the number of time periods, and r is the rate of change.

Now, we have the annual rate of change as:

r = + 0.1% = + 0.1 / 100 = + 0.001

From the function A(x) = a( 1 + r)ˣ , the corresponding factor is 1 + r.

So, let B = 1 + r

B = 1 + r

B = 1 + (+0.001)

B = 1.001

Now, the value of B is greater than 1 therefore, the corresponding growth factor is 1.001.

Learn more about growth and decay factor here:

https://brainly.com/question/16702201

#SPJ4

im stuck help , i would really appreciate it

Answers

Answer:

7. 123

8. 38

10. 65

11. 113

The numbers in this sequence increase by 8 each time.
38 ...
The sequence is continued with the same rule.
Which number in the sequence will be closest to 100?
Optional working
14
22 30

Answers

The number 102 in the sequence will be closest to 100.

A sequence in which each next term gets increased or decreased from the preceding by a constant value is called an arithmetic progression.

The difference of any two consecutive terms in an arithmetic progression is called the common difference of the AP (arithmetic progression).

Here each terms increases by 8. So, the common difference d is 8.

The first term is given to be 38.

So our sequence will be,

38, 46, 54, 62,...

nth term in an AP can be calculated by using the formula,

aₙ = a₁ + (n-1)d

To find the term nearest to 100,

100 = 32 + (n-1)8

68/8 = (n-1)

9.5 = n

But the value of n can not be a non-integer,

So the term nearest to 100 will be 9th or 10th term.

a₉ = a₁ + (9-1)d

a₉ = 8 + (8 x 8)

a₉ = 94

and,

a₁₀ = a₁ + (10-1)d

a₁₀ = 8 + (9 x 8)

a₁₀ = 102.

We can see,

a₁₀ = 102 is closest to 100.

Hence, 10th term is closest to 100.

To know more about Arithmetic Sequence, visit,

https://brainly.com/question/7882626

#SPJ9

Mark and Gary had a basketball game Saturday. Mark had three times as many rebounds as Gary. If together they had 28 rebounds, how many rebounds did Mark have?

Answers

Answer: 19

Step-by-step explanation:


Draw a scatter plot and find the line of best fit for each set of data. (0,2),(1,4),(2,6.5),(3,8.5),(4,10),(5,12),(6,14)

Answers

The scatter plot is shown in attached images and the line of best fit for the data set is y=1.9821x+2.1937.

The given data set is (0,2),(1,4),(2,6.5),(3,8.5),(4,10),(5,12),(6,14).

Plot the points on a coordinate plane.

Calculate the means of the x -values and the y -values.

[tex]\begin{aligned}\bar{X}&=\frac{0+1+2+3+4+5+6}{7}\\ &=\frac{21}{7} \text{ or } 3\\ \bar{Y}&=\frac{2+4+6.5+8.5+10+12+14}{7}\\ &=\frac{57}{7}\text{ or }8.14\end[/tex]

Now, we will calculate the [tex]\sum_{i=1}^{n}(x_{i}-\bar{X})(y_{i}-\bar{Y})[/tex] and [tex]\sum_{i=1}^{n}(x_{i}-\bar{X})^{2}[/tex], we get

[tex]\sum_{i=1}^{n}(x_{i}-\bar{X})^{2}=28[/tex]

and [tex]\sum_{i=1}^{n}(x_{i}-\bar{X})(y_{i}-\bar{Y})=55.5[/tex]

Calculate the slope.

[tex]\begin{aligned}m&=\frac{\sum_{i=1}^{n}(x_{i}-\bar{X})(y_{i}-\bar{Y})}{\sum_{i=1}^{n}(x_{i}-\bar{X})}\\ &=\frac{55.5}{28}\\ &=1.9821\end[/tex]

Calculate the y -intercept.

Use the formula to compute the y -intercept.

[tex]\begin{aligned}b&=\bar{Y}-m\bar{X}\\ &=8.14-(1.9821\times3)\\ &=8.14-5.9463\\ &=2.1937\end[/tex]

Use the slope and y -intercept to form the equation of the line of best fit.

The slope of the line is 1.9821 and the y -intercept is 2.1937 .

Therefore, the equation is y=1.9821x+2.1937 .

Draw the line on the scatter plot.

Hence, the scatter plot is shown in attached image and the line of best fit for given data set (0,2),(1,4),(2,6.5),(3,8.5),(4,10),(5,12),(6,14) is y=1.9821x+2.1937.

Learn more about the scatter plot from here brainly.com/question/27841050

#SPJ4

PLEASE I REALLY NEED HELP !!!

79°
73°
Find the value of the missing angle x.
||
२००

Answers

Answer:

152 =x

Step-by-step explanation:

180 - 152= 28

180-28= 152

Riverstones Whitewater Rafting charges $77.25 per person for a half-day rafting trip. Karen, her mom, and her dad take a half-day rafting trip and then buy 1 souvenir water bottle for $7.99 after the trip. How much money did Karen's family spend in all?​

Answers

Answer: $239.74 :)

Step-by-step explanation:231.75 for Karen, mom, and dad's rafting, plus 7.99 for the water bottle=239.74 USD

someone please help me i’ve been stuck on this for the longest

Answers

Answer:

-3/2

Step-by-step explanation:

Slope:

Rise: The difference between the y -coordinates of the two points is called the rise.

Run: The difference between the x-coordinates of the same two points is called the run.

First plot two points on the line.

(0, 6 )  and (4 , 0)

Rise = 6 - 0 = 6

Run = 0 - 4 = -4

[tex]\sf \boxed{Slope = \dfrac{Rise}{Run}}[/tex]

          [tex]\sf =\dfrac{6}{-4}\\\\=\dfrac{-3}{2}[/tex]

44. The Loveland town council wants to build a bandstand. Architects were asked to submit plans. In the plan shown, the floor has the shape of a regular octagon. a) What is the area of the floor of the bandstand in this plan? 20 ft b) What would the dimensions be of a square bandstand with the same area as the octagon above? c) Which one has the largest perimeter? ​

Answers

Area of the floor of the bandstand in regular octagon is  1931.2 ft²

dimensions of a square bandstand with the same area as the octagon is 43.94 ft

square bandstand has largest perimeter.

floor has the shape of a regular octagon

Area of a regular octagon = 2a²(1+[tex]\sqrt{2}[/tex])

a = length of the side of the octagon

here a = 20 ft

Area = 2a²(1+[tex]\sqrt{2}[/tex]) = 2(20)(20)(1+[tex]\sqrt{2}[/tex])

                           = 800(1+1.414)

                           = 800(2.414)

                           = 1931.2 ft²

square bandstand with the same area as the octagon

Area of square = b²

b = length of the side of the square

1931.2 = b²

b = 43.94 ft

Perimeter of regular octagon = 8a

                                                = 8(20)

                                                = 160ft

Perimeter of Square = 4b

                                  = 4(43.94)

                                  = 175.78ft

area of the floor of the bandstand in regular octagon is  1931.2 ft²

dimensions of a square bandstand with the same area as the octagon is 43.94 ft

square bandstand has largest perimeter.

To learn more about perimeter visit ,https://brainly.com/question/16922713

#SPJ9

[tex]5xx^{2} -9x-10[/tex]

Answers

Answer:

Step-by-step explanation:

5

2

−9x−10

Calculate 5 to the power of 2 and get 25.

25−9x−10

1

Calculate 10 to the power of 1 and get 10.

25−9x−10

Subtract 10 from 25 to get 15.

15−9x

Other Questions
1234PARKWhat did Abigail Adams ask the founders of the new government?O to remember women's rightsO to give unlimited power to landownersOto write about the American RevolutionO to increase educational opportunities for boys 34. Samir can rent a moving truckfrom Company A for $135 plus$0.50 per mile or from Company Bfor $125 plus $0.70 per mile. Whichstatement is true? Renting from Company A willalways be cheaper. Renting from Company B willalways be cheaper.Renting from both companieswill cost the same if Samir drivesthe truck 50 miles.Renting from Company B will becheaper if Samir drives the truck100 miles. Multiply the number by 4. Add 6 to the product. Divide this sum by 2. Subtract 3 from the quotient. Please answer as soon as possible correctly I have 3 questions the first one is What is an algebraic expression for 10 more than the product of 9 and a number y? And the second one is Evaluate the following expression: (10 - 3y) - 1 , if y = 3. last one is Find the Quotient: 55 -211 how does history tell time? Water is an excellent solvent. With water being a polar molecule, it can be an especially strong solvent for other polar molecules. Give an example of how water acting as a solvent is important for living organisms. Which sentence use description to develop the narrador personality? Select three options I live on Greene street I answered handing my registration to the secretary i remember that song and it always makes me feel a little sad to heart it I admitted to Rosie I knelt down next to the woman dog and said hes beautiful dog what his name you just say that because youre jealous I said to Marty as I put my license back in my wallet heres your change maam i answered putting the money into her hand bill by bill important stakeholders exist both inside and outside of an organization. this activity is important because managers must know how to operate in the two organizational environments that house these stakeholdersthe internal environment and the external environment. the goal of this activity is to test your knowledge of an organizations external environment, which is made up of the task environment and the general environment. An online music store is having a promotion. Customers receive a $ 5 rebate if they buy any regular priced CD at $ 13 each. They can also recelve 15% off if they register as a store member.c. Use your answer from part (b) to determine the amount a customer will save if she buys 5 CDs. Find the measure of Francisco studied design and botany in college. He loves to work outside and has a great imagination. What company in the Architecture and Construction career cluster might be interested in hiring Francisco?A. a plumbing company in need of an apprenticeB. a landscaping company looking for an architectC. a chainsaw manufacturer in need of a shift supervisorD. a paint store looking for a sales representative What is 8,524,630.719 in word form?A: Eight million five hundred twenty-four thousand six hundred three and seven hundred nineteen hundredthsB: Eight million five hundred twenty-four thousand six hundred thirty and seven hundred nineteen thousandthsC: Eight million five hundred twenty- four and six hundred thirty and seven hundred nineteen tenthsD: Eight million five hundred and twenty-four and six hundred thirty ones and seven hundred nineteen thousandths at a clothing store a pair of jeans costs 50$. Using a coupon, shanice can pay 20$ less than the original price. Determine the percentage off the original price the coupon represents. Show your work in the space provided. The coupon gives shanice _____% off the original price. HELP HELP Select the viewpoint each quotation expresses."Slavery soon proved its ability to divest her of . . . heavenly qualities.""Slavery proved as injurious to her as it did to me.""She was not satisfied with simply doing as well as he had commanded." Explain how political, social, and economic concerris can affect sciento MJ Comprehensive Science What does 'angiosperm' mean and what structures do these plants contain differently from gymnosperms? In Ancient Egyptian civilization, the firstPharaoh (Narmer) did which of thefollowing in 3000 BCE?A. Created farming on the NileC. Merged Lower and UpperEgyptB. Opened trade with EuropeD. Split Egypt into zones What is the inverse of this function?f(x)=x+ 3, x 3f-(x) =x--for x round the square root of 62 to 1 dp