??? need this answer asap :,)

??? Need This Answer Asap :,)

Answers

Answer 1

Answer:

[tex]\frac{1}{8b^6 a^12}[/tex]

Step-by-step explanation:

Hope this helps you :))


Related Questions

There were four hundred fifty-seven employees working in an office building. fifty-two of them left to go have lunch. 204 cars are still in the parking lot. how many emplyees are left in the building

Answers

The correct answer is 405

im stuck help , i would really appreciate it

Answers

Answer:

7. 123

8. 38

10. 65

11. 113

The coordinated of point T are (0,4). The midpoint of ST is (4,-5). Find the coordinates of point S

Answers

Answer:

(8,-14)

Step-by-step explanation:

mid piont is (4,-5) So let us consider that S(x,y)

Now,

from mid point formula,

[tex]4 = \frac{x + 0}{2} \\ x = 8[/tex]

[tex] - 5 = \frac{y + 4}{2} \\ - 10 = y + 4 \\ y = - 10 - 4 \\ y = - 14[/tex]

simplify completely 5√28+√63

Answers

The expression is completely simplified to give 13√7

What are surds?

Surds are defined as square root values that cannot be further decreases to integers or whole numbers.

Another name for surds are irrational numbers.

Given the surd forms;

5√28 + √63

Now, let's find the factors of the value 28 with perfect squares.

√28 = √4 × 7

The factors of 63 with perfect squares

√63 = √9 × 7

Now, let's substitute the values

5√4 × 7 + √9 × 7

Find the perfect squares

5 × 2√7 + 3√7

Multiply through

10√7 + 3√7

Since the values have common roots, add the coefficient and keep the root the same.

We have;

13√7

Thus, the expression is completely simplified to give 13√7

Learn more about surds here:

https://brainly.com/question/840021

#SPJ1

44. The Loveland town council wants to build a bandstand. Architects were asked to submit plans. In the plan shown, the floor has the shape of a regular octagon. a) What is the area of the floor of the bandstand in this plan? 20 ft b) What would the dimensions be of a square bandstand with the same area as the octagon above? c) Which one has the largest perimeter? ​

Answers

Area of the floor of the bandstand in regular octagon is  1931.2 ft²

dimensions of a square bandstand with the same area as the octagon is 43.94 ft

square bandstand has largest perimeter.

floor has the shape of a regular octagon

Area of a regular octagon = 2a²(1+[tex]\sqrt{2}[/tex])

a = length of the side of the octagon

here a = 20 ft

Area = 2a²(1+[tex]\sqrt{2}[/tex]) = 2(20)(20)(1+[tex]\sqrt{2}[/tex])

                           = 800(1+1.414)

                           = 800(2.414)

                           = 1931.2 ft²

square bandstand with the same area as the octagon

Area of square = b²

b = length of the side of the square

1931.2 = b²

b = 43.94 ft

Perimeter of regular octagon = 8a

                                                = 8(20)

                                                = 160ft

Perimeter of Square = 4b

                                  = 4(43.94)

                                  = 175.78ft

area of the floor of the bandstand in regular octagon is  1931.2 ft²

dimensions of a square bandstand with the same area as the octagon is 43.94 ft

square bandstand has largest perimeter.

To learn more about perimeter visit ,https://brainly.com/question/16922713

#SPJ9


Anursery owner buys 8 panes of glass to fix some damage to his greenhouse. The 8 panes cost $18 80. Unfortunately, he breaks 3 more panes while repaining the damage. What is the cost of another
3 panes of glass?
Another 3 panes of glass cost:

Answers

Answer:

Step-by-step explanation:

If 8 panes cost 1880

then 1 pane cost 1880 divided by 8

1 pane = $ 235

3 pane = $235 x 3

            = $ 705

$1715 + $705 = $ 2420


Let f(x)=2 x+5 and g(x)=x²-3 x+2 . Perform each function operation, and then find the domain.
f(x)-2 g(x)

Answers

The values for f(x)-2 g(x) = -2x² + 8x - 1

What are the domain of the function  f(x)-2 g(x)?

Given :  f(x)=2 x+5

            g(x)=x²-3 x+2

Solution:

            2g(x)=2x²-6x+4

            f(x)-2 g(x) = 2 x+5 - (2x²-6x+4)

            f(x)-2 g(x) = 2 x+5 - 2x² + 6x - 4

            f(x)-2 g(x) = -2x² + 8x - 1

To learn more about the domain, visit;

https://brainly.com/question/956872

#SPJ4

[tex]5xx^{2} -9x-10[/tex]

Answers

Answer:

Step-by-step explanation:

5

2

−9x−10

Calculate 5 to the power of 2 and get 25.

25−9x−10

1

Calculate 10 to the power of 1 and get 10.

25−9x−10

Subtract 10 from 25 to get 15.

15−9x

3(w-2)=9 please
answer

Answers

Answer:

w=5

Step-by-step explanation:

3(w-2)=9

3w-6=9

w=5

Answer:

w = 5

Step-by-step explanation:

The equation is 3(w - 2) = 9
1st : Distribute 3 to w and -2
    Should equal 3w and -6
2nd : Add 6 on both sides
    Should equal 3w = 15
3rd : Divide 3 on both sides
    Should equal w = 5

Hope this helps!
--Blu

What’s 181 x 42 step by step

Answers

answer: 7,602

explanation: 2×3×7×181

Answer:7602

Step-by-step explanation:First line up the numbers vertically and match the places from the right like this.

181

942

* ​____

Now multiply the first number with the 1 st  digit in 2 nd

 number to get intermediate results. That is Multiply 181 with 2. Write the result 362 at the end leaving 0 spaces to the right like this.

181

42

*​_____

362

Now multiply the first number with the 2nd digit in 2nd

 number to get intermediate results. That is Multiply 181 with 4. Write the result 724 at the end leaving 1 spaces to the right like this.

181

42

*______

362

724

​______-

Now add the intermediate results to get final answer.

181

42

*_____

362

724

______

​7602

The number below is not correctly written in scientific notation.

0.0038 × 105
What is the new exponent for the power of 10 after rewriting the number correctly in scientific notation?

3.8 × 10?

Write the new exponent value in the blank below.

Answers

Answer: use a picture math thing

Step-by-step explanation:0.0038 x 105=0.399 so move the decimal point over 1 then it should look like 0.038 x 10.5=0.399 then repeat.

The numbers in this sequence increase by 8 each time.
38 ...
The sequence is continued with the same rule.
Which number in the sequence will be closest to 100?
Optional working
14
22 30

Answers

The number 102 in the sequence will be closest to 100.

A sequence in which each next term gets increased or decreased from the preceding by a constant value is called an arithmetic progression.

The difference of any two consecutive terms in an arithmetic progression is called the common difference of the AP (arithmetic progression).

Here each terms increases by 8. So, the common difference d is 8.

The first term is given to be 38.

So our sequence will be,

38, 46, 54, 62,...

nth term in an AP can be calculated by using the formula,

aₙ = a₁ + (n-1)d

To find the term nearest to 100,

100 = 32 + (n-1)8

68/8 = (n-1)

9.5 = n

But the value of n can not be a non-integer,

So the term nearest to 100 will be 9th or 10th term.

a₉ = a₁ + (9-1)d

a₉ = 8 + (8 x 8)

a₉ = 94

and,

a₁₀ = a₁ + (10-1)d

a₁₀ = 8 + (9 x 8)

a₁₀ = 102.

We can see,

a₁₀ = 102 is closest to 100.

Hence, 10th term is closest to 100.

To know more about Arithmetic Sequence, visit,

https://brainly.com/question/7882626

#SPJ9

The probability mass function of a binomial distribution is given as

Select one:

a. 1x! ℮-λ λx

b. n!x!n-x! px (1-p)n-x

c. px (1-p)n-x

d. ℮-λ λx

Answers

The probability mass function of the binomial distribution is given by:

B. [tex]\frac{n!}{x!(n-x)!} \times p^{x} \times (1-p)^{n-x}[/tex]

What is the binomial distribution formula?

The formula is:

[tex]P(X = x) = C_{n,x}.p^{x}.(1-p)^{n-x}[/tex]

[tex]C_{n,x} = \frac{n!}{x!(n-x)!}[/tex]

The parameters are:

x is the number of successes.n is the number of trials.p is the probability of a success on a single trial.

Hence, considering the combination formula, the probability mass function of the binomial distribution is given by:

B. [tex]\frac{n!}{x!(n-x)!} \times p^{x} \times (1-p)^{n-x}[/tex]

More can be learned about the binomial distribution at https://brainly.com/question/24863377

#SPJ1

find the midpoint of points A(8,10)and B(0,5) graphically

Answers

Answer:

Step-by-step explanation:

Midpoint coordinates(x, y)  of 2 points (x1, y1) and (x2, y2) are given by
x = (x1 + x2)/2

y = (y1 + y2)/2

So in this situation

x = (8 + 0)/2 = 8/2 = 4

y = (10 + 5)/2 = 15/2 = 7.5

Midpoint is at (4, 7.5)

Check the graph attached

Kym is renovating the first floor of her house. She bought 750 square feet of laminate flooring and 525 square
feet of carpet and paid $2717.25. She went back to the store and bought an additional 100 square feet of
laminate flooring and 75 square feet of carpet and paid $374.75. Find the cost per square foot of each type of
flooring. equation

Answers

Using simultaneous equations in two variables we get that the cost of laminate is $ 0.65 per sq. feet and the cost of carpet is $ 4.12 per sq. feet.

Equations in algebra that involve two or more variables simultaneously, such as x and y, are referred to as simultaneous equations. The equations are referred to as simultaneous equations since they are solved simultaneously. There are countless possible solutions to just these equations.

A set of finite equations for which common solutions are sought makes up a system of equations, often known as an equation system.

Let the cost per sq feet of laminate be x and the cost per sq feet of carpet be y.

Now it is given that the cost of 750 sq feet of laminate and 525 square foot of carpet is $2717.25

∴ 750x+525y=2717.25

Again  the cost of 100 sq feet of laminate and 75 square foot of carpet is $374.75

∴ 100x + 75 y = 374.15

Now we solve the pair of simultaneous equations to find the value of x and y:

Multiplying the second equation by 7 and subtracting from the first we get:

750x + 525y =  2717.25

600x + 575 y = 2619.05

150x = 98.20

or, x = 0.654...

Substituting this  value in the first equation we get:

y= 4.115...

Therefore the solution of the simultaneous equation is:

x = $ 0.65 and y = $ 4.12

Therefore  the cost of laminate is $ 0.65 per sq. feet and the cost of carpet is $ 4.12 per sq. feet.

To learn more about simultaneous equations visit:

https://brainly.com/question/16763389

#SPJ1

You score 84 points in 5 games. How many points do you score per game?

Answers

Answer:

16.8

Step-by-step explanation:

84 / 5 = 16.8

Answer:

17 points(Rough estimate)

Step-by-step explanation:

Using long division,

[tex]5|84\\5 \times 1 = 5\\8 - 5 = 3\\\mathrm{Drop~4~onto~3~to~get~34}\\5 \times 6 = 30\\34 - 30 = 4[/tex]

Round 16 to nearest ones place

[tex]\mathrm 16 = 17[/tex]

Therefore,

You scored ≈ 17 points per game out of 5 games.

if you need the exact value, it's 16.8

Any concerns, let me know. Have a good day!


For each annual rate of change, find the corresponding growth or decay factor. +0.1%

Answers

The growth factor for the annual rate of change +0.1 % is 1.001.

A quantity must vary by a specific percentage each time period in order for growth or decay to be exponential.

With the function displayed to the right, you may represent exponential growth or decay.

A(x) = a( 1 + r)ˣ

Where A is the amount after x time periods, a is the initial amount, x is the number of time periods, and r is the rate of change.

Now, we have the annual rate of change as:

r = + 0.1% = + 0.1 / 100 = + 0.001

From the function A(x) = a( 1 + r)ˣ , the corresponding factor is 1 + r.

So, let B = 1 + r

B = 1 + r

B = 1 + (+0.001)

B = 1.001

Now, the value of B is greater than 1 therefore, the corresponding growth factor is 1.001.

Learn more about growth and decay factor here:

https://brainly.com/question/16702201

#SPJ4

Solve this linear quadratic system

y = 3x + 4
y + x² = 0

Answers

Answer:

x = -1, y = 1

Step-by-step explanation:

Solve the following system:

{y = 3 x + 4 | (equation 1)

y = x + 2 | (equation 2)

Express the system in standard form:

{-(3 x) + y = 4 | (equation 1)

-x + y = 2 | (equation 2)

Subtract 1/3 × (equation 1) from equation 2:

{-(3 x) + y = 4 | (equation 1)

0 x + (2 y)/3 = 2/3 | (equation 2)

Multiply equation 2 by 3/2:

{-(3 x) + y = 4 | (equation 1)

0 x + y = 1 | (equation 2)

Subtract equation 2 from equation 1:

{-(3 x) + 0 y = 3 | (equation 1)

0 x + y = 1 | (equation 2)

Divide equation 1 by -3:

{x + 0 y = -1 | (equation 1)

0 x + y = 1 | (equation 2)

Collect results:

Answer: {x = -1, y = 1

PLEASE I REALLY NEED HELP !!!

79°
73°
Find the value of the missing angle x.
||
२००

Answers

Answer:

152 =x

Step-by-step explanation:

180 - 152= 28

180-28= 152

Mark and Gary had a basketball game Saturday. Mark had three times as many rebounds as Gary. If together they had 28 rebounds, how many rebounds did Mark have?

Answers

Answer: 19

Step-by-step explanation:

show that theorem 2.6, the additive law of probability, holds for conditional probabilities. that is, if a, b, and c are events such that p(c) > 0, prove that p(a ∪ b|c)

Answers

P(AUB|C)=P(A|C) + P(B|C) - P(AnB|C) is the correct answer.

From distributive law we have,

P((AUB)nC)=P(AnC) + P(BnC)-P(AnBnC)

Dividing both sides by P(C)

P((AUB)nC)/P(C)=P(AnC)/P(C) + P(BnC)/P(C) - P(AnBnC)/P(C)

P(AUB|C)=P(A|C) + P(B|C) - P(AnB|C)

For more information on additive law click on the link below:

https://brainly.com/question/27791673

#SPJ4

F(2x) graph and domain and range

Answers

The domain of the expression is all real numbers except where the expression is undefined. In this case, there is no real number that makes the expression undefined.

Interval Notation:

                             ( -∞ , ∞ )

Set-Builder Notation:

                                  { x | x ∈ R }

The range is the set of all valid  y  values. Use the graph to find the range.

Interval Notation:

                               ( -∞ , ∞ )

Set-Builder Notation:

                                 { y | y ∈ R }

Determine the domain and range.

Domain:  ( −∞ , ∞ ), { x | x ∈ R }

Range:  ( −∞ , ∞ ), { y | y ∈ R }

Learn more about event correlation here: brainly.com/question/24457122

#SPJ9

HELP!! 30 POINTS!
The sum of three consecutive integers is -51. Find the value of the greatest of the three.

Answer:

Answers

Answer: 16, 17, and 18.

Step-by-step explanation: What I'll do I'll just let explain how to solve it and that will instantly solve your question!

The first case of business to make things easier would be to try and put this on a linear equation so...

Let the first integer be x.

Then the next consecutive two integers will be x + 1 and x + 2

x + (x + 1) + (x + 2) = 51 [Sum of the 3 consecutive integers is 51]

-> 3x + 3 = 51

-> 3x = 51 - 3

-> 3x = 48

-> x = 48/3

-> x = 16,

Thus, x + 1 = 17, x + 2 = 18

Therefore, the three consecutive integers are 16, 17, and 18.

Hope it helps ^^

someone please help me i’ve been stuck on this for the longest

Answers

Answer:

-3/2

Step-by-step explanation:

Slope:

Rise: The difference between the y -coordinates of the two points is called the rise.

Run: The difference between the x-coordinates of the same two points is called the run.

First plot two points on the line.

(0, 6 )  and (4 , 0)

Rise = 6 - 0 = 6

Run = 0 - 4 = -4

[tex]\sf \boxed{Slope = \dfrac{Rise}{Run}}[/tex]

          [tex]\sf =\dfrac{6}{-4}\\\\=\dfrac{-3}{2}[/tex]

Please Help, Consider the following sets in the universal set U, which is the set of all elements of the three given sets below. List the elements of the sets being described.
B = {d, o, I, e} I = {p, i, n, a, y} J = {p, i, n, o, y}

Answers

The solutions are;

1. U = {a, d, e, i, l, n, o, p, y}

2. E ∪ I = {a, d, e, i, l, n, o, p, y}

3. E ∩ I = { }

4. J' = {a, d, e, l}

5. I ∪ J = {p, i, n, a, o, y}

6.( J ∩ I ) ∪ E = {d, o, l, e, p, i, n, y}

7. E' = {a, i, n, p, y}

8. I' ∪ J = {d, e, l, o, p, i, n, y}

9. (E ∩ I) ∩ (I ∪ J) = { }

10. (J ∪ I)' = {d, e, l}

What is Union of the set?

Union of two or more set is the set containing all the elements of the given set.

Here, U is the universal set, which is the set of all elements of the three given sets.

And, Three sets are;

⇒ E = {d, o, I, e},     I = {p, i, n, a, y},     J = {p, i, n, o, y}

Now, We find the universal set as;

1. U = {{a, d, e, i, l, n, o, p, y}

2. And, E ∪ I =  {d, o, I, e} ∪ {p, i, n, a, y}

                = {a, d, e, i, l, n, o, p, y}

Hence, E ∪ I = {a, d, e, i, l, n, o, p, y}

3.  E ∩ I =  {d, o, I, e} ∩ {p, i, n, a, y}

Since, It cannot contain any common elements.

So, Intersection of E and I is null set.

Hence, E ∩ I = { }

4. Since, J' = U - J

J' = {a, d, e, i, l, n, o, p, y} - {p, i, n, o, y}

J' = {a, d, e, l}

Hence, J' = {a, d, e, l}

5. I ∪ J = {p, i, n, a, y} ∪ {p, i, n, o, y}

           = {p, i, n, a, o, y}

Hence,  I ∪ J = {p, i, n, a, o, y}

6. ( J ∩ I ) ∪ E = ({p, i, n, o, y} ∩ {p, i, n, a, y}) ∪ {d, o, I, e}

                     = {p, i, n, y} ∪ {d, o, I, e}

                     = {d, o, l, e, p, i, n, y}

Hence, ( J ∩ I ) ∪ E = {d, o, l, e, p, i, n, y}

7.  E' = U - E

       = {a, d, e, i, l, n, o, p, y} - {d, o, I, e}

       = {a, i, n, p, y}

Hence, E' = {a, i, n, p, y}

8.  I' ∪ J = (U - I) ∪ J

            = ( {a, d, e, i, l, n, o, p, y} - {p, i, n, a, y}) ∪ {p, i, n, o, y}

            = {d, e, l, o} ∪ {p, i, n, o, y}

            =  {d, e, l, o, p, i, n, y}

Hence, I' ∪ J = {d, e, l, o, p, i, n, y}

9. (E ∩ I) ∩ (I ∪ J) = ( {d, o, I, e} ∩ {p, i, n, a, y}) ∩ ({p, i, n, a, y} ∪ {p, i, n, o, y})

                          = { } ∩ {p, i, n, a, o, y}

                          = { }

Hence,  (E ∩ I) ∩ (I ∪ J) = { }

10. (J ∪ I)' = U - (J ∪ I)

              = {a, d, e, i, l, n, o, p, y} - ({p, i, n, a, y} ∪ {p, i, n, o, y})

              = {a, d, e, i, l, n, o, p, y} - {p, i, n, a, o, y}

              =  {d, e, l}

Hence,  (J ∪ I)' = {d, e, l}

So, The solutions are;

1. U = {a, d, e, i, l, n, o, p, y}

2. E ∪ I = {a, d, e, i, l, n, o, p, y}

3. E ∩ I = { }

4. J' = {a, d, e, l}

5. I ∪ J = {p, i, n, a, o, y}

6.( J ∩ I ) ∪ E = {d, o, l, e, p, i, n, y}

7. E' = {a, i, n, p, y}

8. I' ∪ J = {d, e, l, o, p, i, n, y}

9. (E ∩ I) ∩ (I ∪ J) = { }

10. (J ∪ I)' = {d, e, l}

Learn more about the union of set visit:

https://brainly.com/question/1441698

#SPJ1

Riverstones Whitewater Rafting charges $77.25 per person for a half-day rafting trip. Karen, her mom, and her dad take a half-day rafting trip and then buy 1 souvenir water bottle for $7.99 after the trip. How much money did Karen's family spend in all?​

Answers

Answer: $239.74 :)

Step-by-step explanation:231.75 for Karen, mom, and dad's rafting, plus 7.99 for the water bottle=239.74 USD

Based on the stemplot, which of the following is a correct comparison of the eastern and western states’ expenditures?

Answers

Going by the stemplot, a correct comparison to make between eastern and western states’ expenditures is The eastern states have, on average, a higher per-pupil expenditure than the western states.

How to read a stemplot?

Reading a stemplot requires looking at the stem first which is the number in the middle. Then combine this with the leaf to find the actual number. For instance, a stem of 7 and a leaf of 6 in the attached photo is $76,000.

From the attached photo, we see that the Eastern states have more numbers of per-pupil expenditure which means that on average, they have a higher per-pupil expenditure than the western states.

Options for this question are:

The western states exhibit more variability in their expenditures than the eastern states. The eastern states have, on average, a higher per-pupil expenditure than the western states. The distribution of per-pupil expenditures in the eastern states is more symmetric than the distribution of the western states. The distribution of the western states' per-pupil expenditure is skewed left, while the distribution of the eastern states' per-pupil expenditure is skewed right. Valid conclusions comparing the distributions cannot be made, since there is a different number of states in each group.

Find out more on stemplots at https://brainly.com/question/22400218

#SPJ1

The following frequency table summarizes yesterday's orders at Sizzlin' Skillets.
Type of stir fry Number of orders
Vegetable 333
Chicken 666
Pork 222
Beef 222
Shrimp 555
Based on this data, what is a reasonable estimate of the probability that the next type of stir fry ordered is shrimp?
Choose the best answer.
Choose 1 answer:
Choose 1 answer:

Answers

The probability that the next type of stir fry ordered is shrimp is 0.28.

Given that, the frequency table provided summarizes yesterday's orders at Sizzlin' Skillets.

What is a frequency table?

A frequency distribution table displays the frequency of each data set in an organized way. It helps us to find patterns in the data and also enables us to analyze the data using measures of central tendency and variance. The first step that a mathematician does with the collected data is to organize it in the form of a frequency distribution table. All the calculations and statistical tests and analyses come later.

The given frequency table is

Type of stir fry         Number of orders

Vegetable                       333

Chicken                           666

Pork                                 222

Beef                                 222

Shrimp                             555

As we know, probability of an event = Number of favourable outcomes / Total number of outcomes

Here, the number of favourable outcomes = 555

The total number of outcomes = 333+666+222+222+555 = 1998

So, the probability of getting shrimp = 555/1998

=0.277≈0.28

Therefore, the probability that the next type of stir fry ordered is shrimp is 0.28.

To learn more about the probability visit:

https://brainly.com/question/16484393.

#SPJ1

ZA and ZB are supplementary angles. If m/A= (2x - 20)° and m
LB = (3x+15)°, then find the measure of ZB.

Answers

The required measure for the supplementary angles EB is calculated as 126°.

Given that,
Two supplementary angles are given ZA and ZB.
ZA = 2x - 20 ; ZB = 3x + 15

To determine the measure of ZB.

What is simplification?

The process in mathematics to operate and interpret the function to make the function or expression simple or more understandable is called simplifying and the process is called simplification.

Here,
The sum of the supplementary angle is 180°.
ZA + ZB = 180°
2x - 20 + 3x + 15 = 180
5x - 5 = 180
5x = 180 + 5
5x = 185
x = 37
Now,
the measure of angle,
ZB = 3x + 15
ZB = 3 * 37 + 15
ZB = 126°

Thus, the required measure of the angle EB is 126°.


Learn more about simplification here:
https://brainly.com/question/12501526
#SPJ1

Please Help! Determine the range of the following graph:

Answers

Answer:

- 4 ≤ y ≤ 2 or [ -4; 2 ]

Step-by-step explanation:

The range of the function is the set of all y- values.

The range on the graph can be determined by minimum and maximum points if the graph is continuous.

Looking at the given graph we observe:

The minimum is y = - 4,The maximum is y = 2,The graph is continuous between these two points.

The range is:

- 4 ≤ y ≤ 2 or[ -4; 2 ]
Other Questions
The formula for the area A of a trapezoidA = 1/2 (b + b,)h. Solve for b An economic indicator that combines life expectancy and level of education Can I please have answers to this question The nurse conducts the physical examination of a child. when would the nurse expect to examine the child's ears? name some of the materials used to build the tabernacle. use complete sentences and include at least three specific materials that were used by the builders. A laptop has a listed price of $887.99 before tax. If the sales tax rate is 9.75%, find the total cost of the laptop with sales tax included. An individual has inflamed connective tissue in the lungs. Which of the following best predicts the effect of this inflammation on the individual? 35 91 65 28 What anglemeasures is this? The total weight of 15 boxes is 45 pounds. How muchwould 40 boxes weigh Select all features of ginkgophytes. a. they have lost the gametophyte generation. b. they produce sperm with flagella. c. they produce fruits. d. they are dioecious. e. they produce seeds. What is the incoming angle? Amari and ethan planned an end-of-season soccer party. they purchased 45 hot dogs and 30 individual bags of chips. This is for Personal Finance: I have attached the document below. This needs to be done before the 28th.Creating a New Budget to Meet Your Saving and Spending Needs projectI also need help filling out the chart. 2. Which budgetary category changed the most between your old budget and your new budget? Why? (5 points)3. How does your new budget help you to meet your short-term goal of buying a new laptop? (5 points)4. How does your new budget help you to meet your long-term goal of saving for college? (5 points) A group of 15 students were assigned a novel to read during class. The data below represents the number of pages each student read.8, 8, 10, 11, 12, 12, 13, 14, 16, 16, 18, 18, 18, 20, 24Which of the following box plots correctly summarizes the data? 15. Given the following relation {(2, 1), (-4,5), (1,7), (2, -3), (-1,2)), determine if it is a function. Ready to eat foods may become contaminated by? If there are 2.54 cm in an inch,how many inches are in 225 cm? what would your reaction be to a person's claim that they are right-brained or left-brained? in other words, is hemispheric specialization absolute or relative An approach to visualizing and managing capacity that recognizes that nearly all products and services are created through a series of linked process, and in every case, there is at least one process step that limits throughput for the entire chain is the formal definition of?. The fastest animal in the world is the peregrine falcon. it is capable of diving after its prey at an amazing 83.00 meters per second. how fast this is the penguin going in miles per hour? speed conversion tiles a. 128.0 miles/hour b. 185.7 miles/hour c. 298.8 miles/hour d. 371.1 miles/hour