Answer:
ultraviolet radiation
Explanation:
Answer:
ultraviolet
Explanation:
Which of the following is true of BOTH mitochondria and chloroplasts?
• contain DNA
• metabolize molecules to generate ATP
• bounded by two membranes
• site of oxidative metabolism
• arose by endosymbiosis
• use light to synthesize glucose
The statement that is true about both mitochondria and chloroplast is as follows:
contain DNA bounded by two membranes site of oxidative metabolismWhat is mitochondria and chloroplast?Mitochondria is the ovoid shaped organelle found in the cytoplasm of eukaryotic cells and contains genetic material (DNA) separate from that of the host. It is responsible for the conversion of food to usable energy in the form of ATP.
On the other hand, the chloroplast is an organelle found in the cells of green plants where photosynthesis takes place, characterized by a high concentration of chlorophyll and two membranes.
Based on the description of these two organelles, it can be said that both organelles possess the following features;
contain DNA bounded by two membranes site of oxidative metabolismLearn more about chloroplast and mitochondria at: https://brainly.com/question/15033628
#SPJ1
Compounds pure substances made of two or more types of
and are
A compound has the same composition throughout, which is called
Compounds be separated by physical means. Separating a
compound requires a chemical reaction.
The properties of a compound are usually than the properties
of the elements it contains.
Compounds exist as pure substances created of two or more kinds of atoms bound together. Compounds can even be broken down into easier substances.
What is meant by compound?A compound is a substance created by the chemical fusion of two or more elements. Covalent bonds and ionic bonds are two typical forms of bonds that hold components in a compound together. Any compound will always include each ingredient in a specific ratio.
A compound is a pure material that is created when two or more components are chemically mixed in a specific (or constant) mass proportion (or weight). when at least two elements combine chemically to create a compound, a new substance.
Pure substances known as compounds are created by joining two or more different types of atoms. Additionally, compounds can be divided into more basic components.
To learn more about compounds refer to:
https://brainly.com/question/1396488
#SPJ9
In the food chain below, which is the producer?
grass mouse snake hawk
grass
mouse
snake
hawk
Answer:
grass lol
Explanation:
Select the correct answer from each drop-down menu.
Cholera is a bacterial infection of the small intestine. Vaccination provides protection against cholera. The cholera vaccine is made up of a
weakened form of the bacteria that causes cholera The vaccine will stimulate
v| production and elicit an immune response. If the
infection occurs again, the body will produce an even greater attack on the bacteria because of ?
Cholera is a bacterial infection of the small intestine caused by a bacteria called vibrio cholera that causes a large amount of watery diarrhea.
What is vaccination?.
It is a safe and effective way of protecting against harmful diseases by injecting dead or weakened organisms. It builds resistance to specific infections and makes immune system stronger.
Vaccine against cholera is not fully effective and does not protect from other foodborne or waterborne diseases.
Cholera vaccine is made up of live attenuated bacteria and killed bacterial cells which stimulates our immune sysytem.
Vaccines stimulates immune system and it protects our body from infection by producing memory B and T cells that are specific to the bacteria or virus.
This immune cells are quickly activated in the future to produce antibodies and providing greater attack on the bacteria when the same infection occurs again.
Learn more about vaccination from the link given below:
https://brainly.com/question/937188?utm_source=android&utm_medium=share&utm_campaign=question
#SPJ9
.
If a bacterial species is not susceptible to an antibacterial drug at the concentration present in a particular disk, does that necessarily mean the species is completely resistant to the drug? Explain your answer
If a bacterial species is not susceptible to an antibacterial drug at the concentration present in a particular disk,it does not necessarily mean the species is completely resistant to the drug.
What is an Antibiotic?These are chemical compounds which kill or slow down the growth of bacteria through various factors and mechanisms.
Some bacterial species have become susceptible to some antibacterial drug as a result of mutations which occurs during the process of replication and occurs in the genetic material known as the DNA.
Bacterial species not being susceptible to an antibacterial drug at the concentration present in a particular disk means it is only at that exact point in the DNA which is therefore the reason why it it does not necessarily indicate complete resistance to the drugs.
Read more about Antibiotics here https://brainly.com/question/6970037
#SPJ1
The skin is essential in sensing which of the following
Which steps in an experimental investigation are not part of descriptive or
comparative investigations?
A. Asking questions and forming conclusions
B. Making observations and collecting data
C. Testing hypotheses and identifying variables
OD. Using tools and making inferences
SUBMI
Using tools and making inferences is not a part of comparative investigations. The correct option is D.
What is comparative investigations?To make a comparison, comparative investigations involve collecting data on different organisms/objects/features or collecting data under different conditions (e.g., times of year, temperatures, locations).
Descriptive research is used to reach a conclusion or inference. Relationships are determined through comparative studies.
A hypothesis should be established in both comparative and experimental studies.
Subjects in causal-comparative research are already divided into groups because the action or event has already occurred, whereas subjects in experimental research designs are chosen at random prior to variable manipulation.
For more details regarding comparative investigations, visit:
https://brainly.com/question/12042816
#SPJ1
Answer:
B. testing hypotheses and identifying variables
Explanation:
cause im like that;)
Continue your comparison of electron transport chain (ETC) and chemiosmosis in mitochondria and chloroplasts. In each case, a) where do the electrons come from (1 point)? b) how do the electrons get their high potential energy (1 point)? c) what picks up the electrons at the end of the chain (1 point)? d) how is the energy released as electrons are transferred down the ETC used (1 point)?
In mitochondria, electrons come from food molecules, whereas in chloroplast electrons come from splitting of water.
Eectron carriers such as NADH and FADH2 give electrons their high potential energy
Oxygen picks up the electrons at the end of the chain
The energy released as electrons are transferred down the ETC are used to transport H+ across membrane.
What is electron transport chain?The electron transport chain, ETC is a series of four protein complexes that couple redox reactions, creating an electrochemical gradient that leads to the creation of ATP in a complete system named oxidative phosphorylation.
In the comparison of electron transport chain and chemiosmosis in mitochondria and chloroplasts, we have the following
In mitochondria:
a) food moleculesb) electrons have high potential energy in bonds of organic molecules or electron carriers such as FADH2, NADH and cytochrome cc) electrons passed to oxygen, which picks up H+ and forms waterd.) energy released by redox reactions in the electron transport chain used to transport H+ across membrane.In chloroplasts:
a) splitting of waterb.) light energy excites electrons to higher energy levelc) electrons flow from water to reaction-center chlorophyll in photosystem II to the reaction-center chlorophyll in photosystem I to NADP+, reducing it to NADPH.d.) energy released by redox reactions in the electron transport chain used to transport H+ across membrane.Therefore, in the ETC, electrons transferred to oxygen by electron carrier molecules.
Learn more about electron transport chain at: https://brainly.com/question/3489378
#SPJ1
Membranes consist of many different types of fatty acids, which confer different properties, including membrane fluidity. Which of the following fatty acids is the LEAST adaptive to maintaining a fluid membrane at cold temperatures?
a)Myristoleic CH3(CH2)3CH=CH(CH2)7COOH
b)Arachidonic CH3(CH2)4CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH2)3COOH
c) Caprylic CH3(CH2)6COOH
d) Linoleic CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH
The correct answer is Myristoleic CH3(CH2)3CH=CH(CH2)7COOH
Factors affecting membrane fluidity are:
The mosaic structure: The essential lipids and proteins are independent but loosely bound molecules that are present in the membrane.The phospholipids: The phospholipid tails' fatty acids are in their saturated form, which is devoid of double bonds between nearby carbon atoms and saturated with attached hydrogen atoms. As a result, the tails are mostly straight. Unsaturated fatty acids, in comparison, do not have the greatest amount of hydrogen atoms, but they do include some double bonds between nearby carbon atoms; a double bond causes the string of carbons to bend by around 30 degrees. Therefore, if straight-tailed saturated fatty acids are squeezed by lowering temperatures, they press in on each other to create a dense and reasonably rigid membrane. When unsaturated fatty acids are squeezed, the "kinks" in their tails push nearby phospholipid molecules apart, preserving some distance between them. At temperatures where membranes containing saturated fatty acid tails in their phospholipids would "freeze" or "solidify," this "elbow room" aids in maintaining fluidity in the membrane.In a chilly climate, the relative fluidity of the membrane is crucial. Membranes made primarily of saturated fatty acids are often compressed in a cold environment, becoming less fluid and more prone to rupturing.Thus, the correct answer is Myristoleic.
Learn more about membrane fluidity here:
brainly.com/question/14317962
#SPJ9
All of the following are lipids commonly found in the human body except
a. triglyceride
b. cholesterol
c. estradiol
d. albumin
e. phospholipid
All of the following are found in the human body except albumin.
What are lipids?
Lipids are the kinds of fat in the body. Triglycerides, cholesterol, estradiol, and phospholipids are found in the human body.
Albumin is a egg protein found in eggs. More than 95% of the lipids in the diet are composed of triglycerides, which are frequently present in fried meals, butter, milk, cheese, and some meats.
Only around 2 percent of the dietary lipids are phospholipids. They exist in both plants and animals and are water soluble. Estradiol is a kind of steroid hormone.
Therefore, All of the following are found in the human body except albumin.
To learn more about albumin, refer to the link:
https://brainly.com/question/18882874
#SPJ1
The surface area and volume for four cells are given. Which combination of cell dimensions would be considered the MOST metabolically favorable?
A. cell 1: surface area 14 mm^2, volume 33 mm^3
B. cell 2: surface area 20 mm^2, volume 12 mm^3
C. cell 3: surface area 7 mm^2, volume 17 mm^3
D. cell 4: surface area 5 mm^2, volume 2 mm^3
Answer:D
Explanation:
Case study solving please
Which sentence describes an example of an experimental investigation?
A. Students compare the cell structures of plant leaves with the cell
structures of plant roots.
B. Students identify and measure plant cell structures under a
microscope.
C. Students test the effect of light intensity on oxygen production by
plant cells.
D. Students research native plants in their area and learn to identify
them by their features.
The sentence that describes an example of an experimental investigation is Students to test the effect of light intensity on oxygen production by plant cells. The correct option is C.
What is an experimental investigation?An experimental investigation is when someone investigates the reason behind a natural phenomenon. This reason is logical and genuine facts are given.
Finding the light intensity of oxygen production by plant cells is an experimental investigation.
Thus, the correct option is C. Students test the effect of light intensity on oxygen production by plant cells.
To learn more about the experimental investigation, refer to the link:
https://brainly.com/question/12042816
#SPJ1
which of the statements is true about active transport?
A active transport does not require energy.
B active transport occurs automatically.
C active and passive transport are the same thing.
D active transport move molecules against the concentration gradient.
Answer:
D - active transport move molecules against the concentration gradient.
Explanation:
Why was CJD research suspended in France? *
CJD research was suspended in France because following the discovery that a former laboratory employee has been diagnosed with Creutzfeldt-Jakob disease, all publicly financed laboratories in France have suspended using infectious prions for a period of three months.
On July 27, the French government and five of the country's largest public research institutions jointly announced that prions—misfolded proteins thought to be responsible for a number of disorders, including Creutzfeldt-Jakob disease—would no longer be used in research.
The Creutzfeldt-Jakob disease (CJD) patient, whose form is still unknown, is a former INRAE employee. This may be the second instance of infectious CJD affecting a scientist who studied prions, following the death in 2019 of an assistant engineer who contracted the illness after being hurt in an experiment in 2010.
To learn more about Prions visit: https://brainly.com/question/13022105
#SPJ1
Question # 3
Multiple Choice
Recognition of the scene is when
the CSI investigator identifies the victims and
suspects
the CSI officer in charge relieves the first
responder in charge
the CSI security log is begun
O
the entire scope and range of the scene is
established and secured
Which of these is least likely to be used to infer evolutionary relationships? Why?
A. similarities in habitats
B. similarities among embryos of organisms
C. similarities at the genetic and molecular level
D. similarities between living and fossilized organisms
100 POINTS! NEED AN ANSWER NOW!!!
Tyson fell off his skateboard and hit his head. His parents took him to the emergency room to be checked out. Explain how doctors could use each of the following scans to evaluate Tyson's potential injuries:
-CT scan
-MRI
-PET scan
The doctors use CT scan to diagnose the exact position of the blood clotting. Than they use MRI to see the exact image of injury which is inside the brain. At last they use PET scan to know the metabolic function of tissue which get injured.
What is CT scan?CT scan is a medical imaging and it has been a diagnostic imaging which produce a combination of the X-rays as well as computer technology that produce the inner picture of the body.
MRI stands for magnetic resonance imaging and it is a type of scan which has been performed to produce the descriptive snaps of the body from inside.
PET scan stands for positron emission tomography and in PET scan an imaging test conducted that help to identify the metabolic function of a particular tissue.
Therefore, The doctors use CT scan to diagnose the exact position of the blood clotting. Than they use MRI to see the exact image of injury which is inside the brain. At last they use PET scan to know the metabolic function of tissue which get injured.
Learn more about CT scan here:
https://brainly.com/question/28601446
#SPJ1
Why are insects able to evolve faster than vertebrates?
Answer: They had a much longer time to develope their relationships.
Explanation; They also produce much faster so there is more time for them to form the relationship. They also need the resources they can't get on their own.
HOPE THIS HELPED!!
Determine why only the most massive stars are important contributors in enrich-
ing the galaxy with heavy elements.
Although it is far high on the main sequence, a more massive star starts its existence in a similar way, with hydrogen being transformed to helium.
Because of the biochemical and kinetic impression they leave on the environment, massive stars are important forces in the existence of the universe. They are major contributions to the spectrum of galaxies and excellent tracers of stellar evolution in the expansion Of the universe due to their extreme brightness. Understanding the universe requires a precise description of huge stars. Due to their production of powerful stellar winds, intense radiation, and supernova explosions—features essential for the development of galaxies—these stars have a significant impact on their surroundings.
Massive stars, despite being very few in number, have a fundamental impact on the interstellar space and the history of the galaxy because they ionise the encircling gas and deposit potential power first through powerful stellar winds, then as supernovae.
Learn more about Massive stars
https://brainly.com/question/8110709
#SPJ9
Urgently!! I have test tomorrow!! I Need To Know!!
What is the function of the cell wall and what kind of cells have them?
Answer:
The cell wall is an outer protective membrane in many cells including plants, fungi, algae, and bacteria. Animal cells do not have a cell wall. The main functions of the cell wall are to provide structure, support, and protection for the cell
Explanation:
The cell wall's function is to provide structural strength and support as well as protection for the innards of the cell.
All cells other than animal cells have some sort of cell wall. Animals do not need cell walls because they typically have a skeleton, allowing for more free movement. Cell walls provide rigidity to allow for plants to obtain a exoskeleton.
Learn more about cell walls, here:
https://brainly.com/question/965751 - What is the function of the cell wall in plants?
What is habitat loss?
A. when organisms leave their habitat
to migrate to a different location
B. any way that a habitat is changed,
altered, or destroyed
C. when a habitat is expanding
naturally
D. when a species becomes extinct
True or false. Polypeptides are made up of a string of nucleotides ?
Answer:
True
Explanation:
Polypeptides are made from sequence of nucleotides which form a polypeptide chain; all proteins are made from one or more linked polypeptide chains.
Answer:
false
Because not string of nucleotides
Match each cell part to its function by recording the letter of the correct Part of
Cell.
✓
where lipids are produced
breaks down fatty acids,
amino acids, and some
toxins
provides mechanical
supports and anchorage to
the cell
these fibers strengthen or
change of the shape of
eukaryotic cells
1. Cytoskeleton
2. Peroxisomes
3. Microfilaments
4. Smooth Endoplasmic Reticulum
From matching Words With there characteristics we have,
1. Cytoskeleton - 3
2. Peroxisomes - 2
3. Microfilaments - 4
4. Smooth Endoplasmic Reticulum – 1
1. Cytoskeleton
Function: Maintains the cell's form and provides it with mechanical structure. a balance between opposing forces acting on it keeps it stable. provides organelles and enzymes in the cytosol with anchoring. can be taken apart and put back together again to modify the shape of the cell.
As a result of interactions between motor proteins and the cytoskeleton, cells can move and change location.
2. Enzymes are located inside the single membrane-bound peroxisome.
Function: Remove H from different substrates and transfer it to O2, forming H2O2, which is then converted to H2O. metabolizes fatty acids to produce fuel
In the fat-storing tissue of plant seeds are specialized peroxisomes called glyoximes that start the process of converting fat to sugar.
Eukaryotic cells
3. Actin filaments, also known as microfilaments, are protein filaments that make up the cytoskeleton of eukaryotic cells and are found in their cytoplasm. Actin polymers make up the majority of them, but they also interact with and are changed by many other proteins in the cell.
4. Many different responsibilities that the SER plays are frequently highlighted in specific cell types because those roles call for increased SER functionality. The release of glucose from glycogen, calcium storage, drug detoxification, and lipid synthesis are four typical tasks.
Thus, the above given match the column is the right answer.
Learn more about Cytoskeleton:
https://brainly.com/question/14702310
#SPJ9
1 Answer:
Heat of vaporization is the amount of heat required to change a
substance from a liquid to a solid form.
a. true
b. false
2 Answer:
The more unsaturated fatty acids a lipid contains, the "softer" or
more "oily" the lipid will be.
a. true
b. false
3 Answer:
Food chemistry is a study of the characteristics of the substances
of which foods are made.
a. true
b. false
4 Answer:
The simplest life form known is a bacteria, which consists of DNA
or RNA surrounded by a protein coat.
a. true
b. false
5 Answer:
Most carbohydrates are used in the food industry to provide either
bulk or a sweet taste to food products.
a. true
b. false
Answer:1)False2)True3)true4)false5)true
Explanation:1)Heat of vaporization is the amount of heat absorbed when one mole of a liquid is changed into vapours.
2)The close packing of molecules in saturated fatty acids make them solids.While the molecules in unsaturated fatty acids have the bends that dont allow them to pack tightly and they appear as oils.
3)Study Of various chemical constituents of food like carbs,proteins,lipids etc
4) The simplest life form is known as bacteria,but not surrounded by a protein coat.Protein coat(capsid) is a characteristic of virus.
5)carbs give bulkness,sweetness,coating ability,viscosity etc
Explain why a root cell structure needs to be different from a leaf cell
Explanation:
Because the root cells are typically in the dark and cannot do photosynthesis, they lack of chloroplast
how does the geology of a region affect the chemistry of the groundwater
Answer:
Due to different mineral deposits, groundwater may contain different minerals. I think it was in California, not 100% sure, but there was silver in the water a long time ago and now there are veins of silver everywhere.
Places that have lots of calcium and zinc in the ground may create hard water (water that has lots of minerals in it).
Hard water is a problem in many places because it clogs pipes and taps. You may see in your house if you look into the faucet, there can be white buildup. That is minerals from hard water.
Hope that helps
The question is: how does the color of a
candle affect the time it takes the candle to
burn. Time measured in minutes. height
measured in centimeters at regular
intervals of time
and u need to solve what's a indecent
variable, Contants and A dependent
variable
1.In actuality, a candle's color has little to no impact on how quickly it burns. In rare situations, candle color can actually make a candle burn hotter, which causes colored candles to burn more quickly.
2.For every 28 g of wax used, smaller candles with smaller wicks will burn for 7 to 9 hours. Wax is consumed more quickly by larger candles with larger wicks. For every 28 g of wax used, the larger wicks can be anticipated to produce 5 to 7 hours (420 minutes).
3.A candle burns down to a smaller amount of wax than it did at the beginning. This is due to the wax's oxidation, or burning, in the flame, which results in the release of water and carbon dioxide, which dissipate in the surrounding air and produce light and heat. Thus height decreases.
The variable that the experimenter willfully modifies or manipulates is known as an independent variable. The cause, input, or action during the process is the independent variable.
The variable that alters as a result of the changes in the dependent
Independent element The outcome, or what occurs as a result of the dependent variable. The variable that remains constant and unchanging throughout the process is known as a control or constant variable.
To learn more about burning of candle refer - https://brainly.com/question/17694127
#SPJ9
Below are the half reactions for sulfate reduction using acetate as a source of electrons, energy, and carbon.
2CO2 + 8e- -> CH3COO- (-0.29 volts)
SO42- + 8e- -> H2S (-0.22 volts)
Using the information given, calculate the ΔE for this reaction, balance the full reaction to determine n, the number of electrons transferred when 400 moles of SO42- are reduced. Finally, use the simplified Nernst Equation
ΔG = -nFΔE, where F = 96.5 kJ (mol e- × V)-1
to determine the Gibbs Free energy available to do work!
ΔG = -nFΔE , The Gibbs free energy for the reaction is - 27020 KJ
What is Gibbs free energy?The Gibbs free energy shows entropy and enthalpy of a reaction.
ΔG = -nFΔE,
F= 96.5 KJ,
n = 400 moles,
ΔE = -0.29- (-0.22) = -0.29+ 0.22 = -0.7 KJ.
ΔG = -nFΔE,
= 400* 96.5 * -0.7 KJ.
= - 27020 KJ
Therefore, ΔG = -nFΔE , The Gibbs free energy for the reaction is - 27020 KJ
To learn more about Gibbs energy, refer to the link:
https://brainly.com/question/20358734
#SPJ1
Why is it important to identify structures in Prokaryotes that are different from Eukaryotes?
Answer:
I guess it's important to tell the identify structures between the two to determine if you are studying the cells of Bacteria and Archaea, or if you're studying the cells of plants, animals, protists, or fungi.